|
|
| | 3-Methylbenzofuran-2-carboxylic acid Basic information |
| | 3-Methylbenzofuran-2-carboxylic acid Chemical Properties |
| Melting point | 194-197 °C (lit.) | | Boiling point | 328.7±22.0 °C(Predicted) | | density | 1.303±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | Powder | | pka | 2.87±0.30(Predicted) | | color | Beige | | BRN | 132104 | | InChI | InChI=1S/C10H8O3/c1-6-7-4-2-3-5-8(7)13-9(6)10(11)12/h2-5H,1H3,(H,11,12) | | InChIKey | YMZTUCZCQMQFMK-UHFFFAOYSA-N | | SMILES | O1C2=CC=CC=C2C(C)=C1C(O)=O | | CAS DataBase Reference | 24673-56-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29329990 | | Storage Class | 13 - Non Combustible Solids |
| | 3-Methylbenzofuran-2-carboxylic acid Usage And Synthesis |
| Chemical Properties | beige powder | | Uses | 3-Methylbenzofuran-2-carboxylic Acid is a benzofuran based acid used in the preparation of matrix metalloproteinase (MMP) inhibitors for the treatment of osteoarthritis. | | Uses | 3-Methylbenzofuran-2-carboxylic acid may be used in the preparation of 3-methyl-N-phenylbenzofuran-2-carboxamide by reacting with aniline. | | Definition | ChEBI: 3-Methylbenzofuran-2-carboxylic acid is a member of benzofurans. | | General Description | 3-Methylbenzofuran-2-carboxylic acid is a benzofuran derivative. It undergoes palladium-catalyzed cross-coupling reaction with 4-iodoanisole and diphenyliodonium triflate under different reaction conditions to form the corresponding biaryl. |
| | 3-Methylbenzofuran-2-carboxylic acid Preparation Products And Raw materials |
|