|
|
| | 5-(1-Carboxyethyl)-2-(phenylthio)phenylacetic acid Basic information |
| Product Name: | 5-(1-Carboxyethyl)-2-(phenylthio)phenylacetic acid | | Synonyms: | 5-(alpha-Carboxyethyl)-2-Phenylthio-Phenylacetic Acid;5-(-carboxyethyl)-2-phenylthio-phenylacetic acid (intermediate of zaltoprofen);5-(A-CARBOXY ETHYL)-2-PHENYL THIOPHENYL ACETICACID;5-(1-Carboxyethyl)-2-(phenylthio)phenylacetic acid;5-(α-carboxyethyl)-2-phenylthio phenylacetic acid;5-(1-carboxylethyl)-2-phenylthiobenzeneacetic acid;2-[3-acetyloxy-4-(phenylthio)phenyl]propanoic acid;1,3-Benzenediacetic acid, α1-methyl-4-(phenylthio)- | | CAS: | 83237-49-4 | | MF: | C17H16O4S | | MW: | 316.37 | | EINECS: | 1312995-182-4 | | Product Categories: | Organic acids;(intermediate of zaltoprofen) | | Mol File: | 83237-49-4.mol |  |
| | 5-(1-Carboxyethyl)-2-(phenylthio)phenylacetic acid Chemical Properties |
| Melting point | 145-146 °C(Solv: 1,2-dichloroethane (107-06-2)) | | Boiling point | 517.4±50.0 °C(Predicted) | | density | 1.34±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Acetone (Slightly), DMSO (Slightly) | | form | Solid | | pka | 4.09±0.10(Predicted) | | color | Off-White | | InChI | InChI=1S/C17H16O4S/c1-11(17(20)21)12-7-8-15(13(9-12)10-16(18)19)22-14-5-3-2-4-6-14/h2-9,11H,10H2,1H3,(H,18,19)(H,20,21) | | InChIKey | HCKQCCUGCHJSOS-UHFFFAOYSA-N | | SMILES | C(C1C=C(C(C)C(=O)O)C=CC=1SC1C=CC=CC=1)C(=O)O |
| | 5-(1-Carboxyethyl)-2-(phenylthio)phenylacetic acid Usage And Synthesis |
| Chemical Properties | White powder | | Uses | 2-(3-(Carboxymethyl)-4-(phenylthio)-phenyl)propanoic Acid is an intermediate used to prepare Zaltoprofen (Z146000) which is anti-inflammatory. |
| | 5-(1-Carboxyethyl)-2-(phenylthio)phenylacetic acid Preparation Products And Raw materials |
|