|
|
| | 2-Chloro-N-[2-(diethylamino)ethyl]-4-quinolinecarboxamide Basic information |
| | 2-Chloro-N-[2-(diethylamino)ethyl]-4-quinolinecarboxamide Chemical Properties |
| Melting point | 65-67°C | | Boiling point | 470.5±40.0 °C(Predicted) | | density | 1.181±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO, Methanol | | form | Solid | | pka | 12.77±0.46(Predicted) | | color | Off-White to Pale Yellow | | InChI | 1S/C16H20ClN3O/c1-3-20(4-2)10-9-18-16(21)13-11-15(17)19-14-8-6-5-7-12(13)14/h5-8,11H,3-4,9-10H2,1-2H3,(H,18,21) | | InChIKey | WZBLJANCSMJDSS-UHFFFAOYSA-N | | SMILES | Clc1nc2c(c(c1)C(=O)NCCN(CC)CC)cccc2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-Chloro-N-[2-(diethylamino)ethyl]-4-quinolinecarboxamide Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Intermediate in the preparation of Dibucaine. |
| | 2-Chloro-N-[2-(diethylamino)ethyl]-4-quinolinecarboxamide Preparation Products And Raw materials |
|