|
|
| | 2-Amino-5-(trifluoromethoxy)benzoic acid Basic information |
| | 2-Amino-5-(trifluoromethoxy)benzoic acid Chemical Properties |
| Melting point | 138-142 °C | | Boiling point | 296.4±40.0 °C(Predicted) | | density | 1.528±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | form | solid | | pka | 4.56±0.10(Predicted) | | color | Off-white | | InChI | 1S/C8H6F3NO3/c9-8(10,11)15-4-1-2-6(12)5(3-4)7(13)14/h1-3H,12H2,(H,13,14) | | InChIKey | UXNGDCBPIGOZFO-UHFFFAOYSA-N | | SMILES | Nc1ccc(OC(F)(F)F)cc1C(O)=O | | CAS DataBase Reference | 83265-56-9 |
| Hazard Codes | Xn | | Risk Statements | 22-36-43 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HS Code | 2922498590 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Sens. 1 |
| | 2-Amino-5-(trifluoromethoxy)benzoic acid Usage And Synthesis |
| Chemical Properties | mp 138-142°C |
| | 2-Amino-5-(trifluoromethoxy)benzoic acid Preparation Products And Raw materials |
|