| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
all-cis-4,7,10,13,16-Docosapentaenoic acid, C22:5n6 manufacturers
- Osbond acid
-
- $782.00
-
2026-05-11
- CAS:25182-74-5
- Purity:
- Supply Ability: 10g
|
| | all-cis-4,7,10,13,16-Docosapentaenoic acid, C22:5n6 Basic information |
| Product Name: | all-cis-4,7,10,13,16-Docosapentaenoic acid, C22:5n6 | | Synonyms: | all-cis-4,7,10,13,16-Docosapentaenoic acid, C22:5n6;(4Z,7Z,10Z,13Z,16Z)-4,7,10,13,16-Docosapentaenoic acid, (all-Z)-4,7,10,13,16-Docosapentaenoic acid, Osbond acid;Docosapentaenoate;4,7,10,13,16-Docosapentaenoic acid, (4Z,7Z,10Z,13Z,16Z)-;4(Z),7(Z),10(Z),13(Z),16(Z)-Docosapentaenoic acid;(4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoicaci;Ethyl Acetate Impurity 105;all-cis-4,7,10,13,16-Docosapentaenoic acid | | CAS: | 25182-74-5 | | MF: | C22H34O2 | | MW: | 330.5 | | EINECS: | | | Product Categories: | | | Mol File: | 25182-74-5.mol |  |
| | all-cis-4,7,10,13,16-Docosapentaenoic acid, C22:5n6 Chemical Properties |
| Boiling point | 443.8±24.0 °C(Predicted) | | density | 0.932±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | 0.1 M Na2CO3: 1 mg/ml; DMF: >100 mg/ml; DMSO: >100 mg/ml; Ethanol: Miscible | | pka | 4.58±0.10(Predicted) | | form | Liquid | | color | Colorless to light yellow | | biological source | synthetic | | Stability: | Light Sensitive | | Major Application | food and beverages | | InChIKey | AVKOENOBFIYBSA-WMPRHZDHSA-N | | SMILES | OC(CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCC)=O |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | all-cis-4,7,10,13,16-Docosapentaenoic acid, C22:5n6 Usage And Synthesis |
| Uses | all-cis-4,7,10,13,16-Docosapentaenoic Acid is FADS1 genotype modifies metabolic responses to linoleic acid and alpha-linolenic acid containing plant oils-genotype based randomized trial FADSDIET2. | | Definition | ChEBI: (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoic acid is the all-cis-isomer of a C22 polyunsaturated fatty acid having five double bonds in the 4-, 7-, 10-, 13- and 16-positions. It is a member of n-6 PUFA and a product of linoleic acid metabolism. It has a role as a Daphnia tenebrosa metabolite, a human metabolite and an algal metabolite. It is a docosapentaenoic acid and an omega-6 fatty acid. It is a conjugate acid of a (4Z,7Z,10Z,13Z,16Z)-docosapentaenoate. |
| | all-cis-4,7,10,13,16-Docosapentaenoic acid, C22:5n6 Preparation Products And Raw materials |
|