| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Dichlorobis(2-(diphenylphosphino)ethyla& Basic information | | Reaction |
| Product Name: | Dichlorobis(2-(diphenylphosphino)ethyla& | | Synonyms: | Dichlorobis[2-(diphenylphosphino)ethylaMine]rutheniuM(II), Min. 95% (Mixture of isoMers);Dichlorobis[2-(diphenylphosphino)ethylaMine]rutheniuM(II),Min.95%;Dichlorobis(2-(diphenylphosphino)ethylaMine)rutheniuM(II),95%;dichlorobis(2-(diphenylphosphino)ethyla&aMp;Dichlorobis[2-(diphenylphosphino-κP)ethanamine-κN]ruthenium;dichlororuthenium:2-diphenylphosphanylethanamine;2-(diphenylphosphanyl)ethanamine-dichlororuthenium (2:1) | | CAS: | 506417-41-0 | | MF: | 2C14H16NP.Cl2Ru | | MW: | 630.499 | | EINECS: | | | Product Categories: | Ru;organometallic complex | | Mol File: | 506417-41-0.mol |  |
| | Dichlorobis(2-(diphenylphosphino)ethyla& Chemical Properties |
| Melting point | 130-135°C | | form | Powder | | color | yellow | | InChI | 1S/2C14H16NP.2ClH.Ru/c2*15-11-12-16(13-7-3-1-4-8-13)14-9-5-2-6-10-14;;;/h2*1-10H,11-12,15H2;2*1H;/q;;;;+2/p-2 | | InChIKey | BJNVYFXBTNBKRU-UHFFFAOYSA-L | | SMILES | Cl[Ru]Cl.NCCP(c1ccccc1)c2ccccc2.NCCP(c3ccccc3)c4ccccc4 | | CAS DataBase Reference | 506417-41-0 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 28439090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Dichlorobis(2-(diphenylphosphino)ethyla& Usage And Synthesis |
| Reaction | Efficient catalyst for the dihydrogen reduction of carboxylic esters and amides to alcohols.
| | Uses | Catalyst for:
- Synthesis of long chain linear fatty acid esters
- Preparation of ruthenium borohydride complexes for use in hydrogenation reactions
- Dehydrogenation of ammonia boranes
- Chemoselective reduction of carboxylic esters
- Synthesis of ruthenium beta-aminophosphine hydrido/chloro complexes with catalytic activities
| | reaction suitability | core: ruthenium reagent type: catalyst |
| | Dichlorobis(2-(diphenylphosphino)ethyla& Preparation Products And Raw materials |
|