| Company Name: |
chemmole Gold |
| Tel: |
400-168-9330 15013243073 |
| Email: |
597760450@qq.com |
| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
|
| | 2-(Diphenylphosphino)ethylamine Basic information |
| | 2-(Diphenylphosphino)ethylamine Chemical Properties |
| Boiling point | 220 °C(Press: 9 Torr) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 9.56±0.10(Predicted) | | form | liquid | | color | colorless to yellow | | Water Solubility | Insoluble in water. | | Sensitive | Moisture Sensitive | | BRN | 644931 | | InChI | InChI=1S/C14H16NP/c15-11-12-16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12,15H2 | | InChIKey | RXEPBCWNHKZECN-UHFFFAOYSA-N | | SMILES | C(N)CP(C1=CC=CC=C1)C1=CC=CC=C1 | | CAS DataBase Reference | 4848-43-5(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2735 8/PG 3 | | WGK Germany | 3 | | F | 1-10-13 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | 2-(Diphenylphosphino)ethylamine Usage And Synthesis |
| Uses | Ligand used in the preparation of a highly efficient ruthenium catalyst for the chemoselective hydrogenolysis of expoxides. | | Uses | 2-(Diphenylphosphino)ethylamine, is used as a fine chemical intermediate. It is also used as an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand |
| | 2-(Diphenylphosphino)ethylamine Preparation Products And Raw materials |
|