| Company Name: |
VDM Biochemicals
|
| Tel: |
0330-2528181 |
| Email: |
sales@vdmbio.com |
| Products Intro: |
Product Name:BATCP
CAS:787549-23-9
Purity:>=98%
|
| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:BATCP
CAS:787549-23-9
Purity:98% Package:100mg Remarks:S53343
|
| Company Name: |
Tianjin Kailiqi Biotechnology Co., Ltd.
|
| Tel: |
15076683720 |
| Email: |
klq@cw-bio.com |
| Products Intro: |
Product Name:BATCP
CAS:787549-23-9
Purity:大于98% Package:1g,5g,10g,25g根据客户需要分装 Remarks:Not For Human Use, Lab Use Only.
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:BATCP >=98% (HPLC), solid
CAS:787549-23-9
Purity:98% (HPLC), solid Package:2mg Remarks:NULL
|
|
| Product Name: | BATCP | | Synonyms: | Cpd 3b, (S)-[5-Acetylamino-1-(2-oxo-4-trifluoromethyl-2H-chromen-7-ylcarbamoyl)pentyl]carbamic acid tert-butyl ester;(S)-[5-Acetylamino-1-(2-oxo-4-trifluoromethyl-2H-chromen-7-ylcarbamoyl)pentyl]carbamic acid tert-butyl ester;Carbamic acid, N-[(1S)-5-(acetylamino)-1-[[[2-oxo-4-(trifluoromethyl)-2H-1-benzopyran-7-yl]amino]carbonyl]pentyl]-, 1,1-dimethylethyl ester;BATCP >=98% (HPLC), solid;BATCP, HDAC6 substrate;tert-Butyl (S)-(6-acetamido-1-oxo-1-((2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl)amino)hexan-2-yl)carbamate | | CAS: | 787549-23-9 | | MF: | C23H28F3N3O6 | | MW: | 499.48 | | EINECS: | | | Product Categories: | Intracellular signaling. | | Mol File: | 787549-23-9.mol |  |
| | BATCP Chemical Properties |
| storage temp. | 2-8°C | | solubility | DMSO: soluble16mg/mL | | form | solid | | color | Off-white to light yellow | | InChIKey | NVKNRJCOVHAZDK-KRWDZBQOSA-N | | SMILES | CC(=O)NCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)Nc1ccc2c(OC(=O)C=C2C(F)(F)F)c1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | BATCP Usage And Synthesis |
| Uses | BATCP is a HDAC (Histone deacetylases) inhibitor[1]. | | Biological Activity | HDAC 6 selective substrate (over HDAC 1, Class II over Class I). | | References | [1] Hu M, et, al. Preparation method for rejuvenated regenerative fibroblast and application thereof. WO2019210870A1. |
| | BATCP Preparation Products And Raw materials |
|