| Company Name: |
AAB-PHARMA LIMITED Gold |
| Tel: |
025-66800956 18800000000 |
| Email: |
sales@njdmchem.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,4-Difluoro-3-formylphenylboronic acid Basic information |
| | 2,4-Difluoro-3-formylphenylboronic acid Chemical Properties |
| Melting point | 206-210 °C(lit.) | | Boiling point | 332.5±52.0 °C(Predicted) | | density | 1.42±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Acetone (Slightly) | | pka | 7.72±0.58(Predicted) | | form | solid | | color | Off-white | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C7H5BF2O3/c9-6-2-1-5(8(12)13)7(10)4(6)3-11/h1-3,12-13H | | InChIKey | PVAWONNALJEQJH-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(F)C(C=O)=C1F)(O)O |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36 | | WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2,4-Difluoro-3-formylphenylboronic acid Usage And Synthesis |
| | 2,4-Difluoro-3-formylphenylboronic acid Preparation Products And Raw materials |
|