| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2,5-Dibromo-4-(decyloxy)phenol, 99% Basic information |
| | 2,5-Dibromo-4-(decyloxy)phenol, 99% Chemical Properties |
| Melting point | 62-66 °C (lit.) | | InChI | 1S/C16H24Br2O2/c1-2-3-4-5-6-7-8-9-10-20-16-12-13(17)15(19)11-14(16)18/h11-12,19H,2-10H2,1H3 | | InChIKey | SSEJKDGLNTZULX-UHFFFAOYSA-N | | SMILES | CCCCCCCCCCOc1cc(Br)c(O)cc1Br |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,5-Dibromo-4-(decyloxy)phenol, 99% Usage And Synthesis |
| | 2,5-Dibromo-4-(decyloxy)phenol, 99% Preparation Products And Raw materials |
|