| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | -Epoxytricarballylic acid monopotassiu Basic information |
| Product Name: | -Epoxytricarballylic acid monopotassiu | | Synonyms: | -Epoxytricarballylic acid monopotassiu;(±)-Epoxytricarballylic acid monopotassium salt;Aconitic acid oxide potassium salt;(+/-)-Epoxytricarballylic acid monopotassium salt;Lactic Acid Impurity 69 Potassium Salt;Potassium salt of lactic acid impurity 69;(±)-Epoxytricarballylic acid monopotassium salt | | CAS: | 303189-51-7 | | MF: | C6H5O7.K | | MW: | 228.197 | | EINECS: | | | Product Categories: | | | Mol File: | 303189-51-7.mol |  |
| | -Epoxytricarballylic acid monopotassiu Chemical Properties |
| storage temp. | 2-8°C | | form | solid | | InChI | 1S/C6H6O7.K/c7-2(8)1-6(5(11)12)3(13-6)4(9)10;/h3H,1H2,(H,7,8)(H,9,10)(H,11,12);/q;+1/p-1 | | InChIKey | LBTLPBOOVFHIGW-UHFFFAOYSA-M | | SMILES | [K+].OC(=O)CC1(OC1C(O)=O)C([O-])=O |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | -Epoxytricarballylic acid monopotassiu Usage And Synthesis |
| | -Epoxytricarballylic acid monopotassiu Preparation Products And Raw materials |
|