| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- nitroso-R salt
-
- $1.00
-
2019-07-06
- CAS:525-05-3
- Min. Order: 1kg
- Purity: 95%-99%
- Supply Ability: 1000kg
|
| | 1-Nitroso-2-naphthol-3,6-disulfonic acid disodium salt Basic information |
| Product Name: | 1-Nitroso-2-naphthol-3,6-disulfonic acid disodium salt | | Synonyms: | LABOTEST-BB LT00454615;DISODIUM 1-NITROSO-2-NAPHTHOL-3,6-DISULFONATE;DISODIUM 3-HYDROXY-4-NITROSO-2,7-NAPHTHALENEDISULFONATE;NITROSO R SALTNITROSO R SALTNITROSO R SALT;3-HYDROXY-4-NITROSO-2,7-NAPHTHALENEDISULFONIC ACID DISODIUM SALT;1-Nitroso-2-naphthol-3,6-disul;1-Nitroso-2-naphthol-3,6-disulfonicacidsodiumsalt;2-HYDROXY-1-NITROSO-3,6-NAPHTHALENEDISULFONIC ACID DISODIUM SALT | | CAS: | 525-05-3 | | MF: | C10H8NNaO8S2 | | MW: | 357.28 | | EINECS: | 208-369-1 | | Product Categories: | Intermediates of Dyes and Pigments | | Mol File: | 525-05-3.mol |  |
| | 1-Nitroso-2-naphthol-3,6-disulfonic acid disodium salt Chemical Properties |
| Melting point | >300 °C(lit.) | | solubility | Slightly soluble in methanol and ethanol. | | form | Crystalline Powder | | color | Yellow to orange | | Water Solubility | almost transparency | | Merck | 14,6644 | | BRN | 3643930 | | InChI | InChI=1S/C10H7NO8S2.Na.H/c12-10-8(21(17,18)19)4-5-3-6(20(14,15)16)1-2-7(5)9(10)11-13;;/h1-4,12H,(H,14,15,16)(H,17,18,19);; | | InChIKey | YSJIUHZRNBXDKS-UHFFFAOYSA-N | | SMILES | N(C1=C(C(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=CC=C12)O)=O.[NaH] | | CAS DataBase Reference | 525-05-3(CAS DataBase Reference) | | EPA Substance Registry System | 2,7-Naphthalenedisulfonic acid, 3-hydroxy-4-nitroso-, disodium salt (525-05-3) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | RTECS | QJ6480000 | | TSCA | TSCA listed | | HS Code | 29089990 |
| | 1-Nitroso-2-naphthol-3,6-disulfonic acid disodium salt Usage And Synthesis |
| Chemical Properties | YELLOWISH-ORANGE TO YELLOW-BROWN CRYST. POWDER | | Uses | As a reagent for cobalt and potassium. | | Uses | 1-Nitroso-2-naphthol-3,6-disulfonic acid disodium salt is the most sensitive determination of trace cobalt reagents used for determination of cobalt and potassium-sensitive reagents. | | Purification Methods | Purify the salt by dissolution in aqueous alkali and precipitation by addition of HCl. The pKa is 7.13. [Oka & Miyamoto J Chem Soc Jpn (Pure Chem Sectn) 76 672 1955 (Chem Abstr 11882 1956I), Beilstein 11 IV 669.] |
| | 1-Nitroso-2-naphthol-3,6-disulfonic acid disodium salt Preparation Products And Raw materials |
|