| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | METHYL 4'-CHLORO[1,1'-BIPHENYL]-4-CARBOXYLATE Basic information |
| Product Name: | METHYL 4'-CHLORO[1,1'-BIPHENYL]-4-CARBOXYLATE | | Synonyms: | RARECHEM AL BF 1239;METHYL 4'-CHLORO[1,1'-BIPHENYL]-4-CARBOXYLATE;AKOS BAR-0279;Methyl 4-(4-chlorophenyl)benzoate;Methyl 4'-chlorobiphenyl-4-carboxylate, 95%;[1,1'-Biphenyl]-4-carboxylic acid, 4'-chloro-, methyl ester;Methyl 4'-chloro-[1,1'-biphenyl]-4-carboxylate;Methyl 4′-chloro[1,1′-biphenyl]-4-carboxylate, CAS 89901-02-0 | | CAS: | 89901-02-0 | | MF: | C14H11ClO2 | | MW: | 246.69 | | EINECS: | | | Product Categories: | | | Mol File: | 89901-02-0.mol | ![METHYL 4'-CHLORO[1,1'-BIPHENYL]-4-CARBOXYLATE Structure](CAS/GIF/89901-02-0.gif) |
| | METHYL 4'-CHLORO[1,1'-BIPHENYL]-4-CARBOXYLATE Chemical Properties |
| Melting point | 113-115°C | | Boiling point | 364.1±25.0 °C(Predicted) | | density | 1.205±0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C14H11ClO2/c1-17-14(16)12-4-2-10(3-5-12)11-6-8-13(15)9-7-11/h2-9H,1H3 | | InChIKey | UJIUMBFXWGXMOV-UHFFFAOYSA-N | | SMILES | COC(=O)c1ccc(cc1)-c2ccc(Cl)cc2 | | CAS DataBase Reference | 89901-02-0 |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| | METHYL 4'-CHLORO[1,1'-BIPHENYL]-4-CARBOXYLATE Usage And Synthesis |
| Uses | Methyl 4-(4-Chlorophenyl)benzoate is used in the preparation of ionic compound-supported palladium complex as catalyst for suzuki-Miyaura coupling of aryl halides. |
| | METHYL 4'-CHLORO[1,1'-BIPHENYL]-4-CARBOXYLATE Preparation Products And Raw materials |
|