| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1,1'-Diethyl-4,4'-cyanine iodide Basic information |
| | 1,1'-Diethyl-4,4'-cyanine iodide Chemical Properties |
| Melting point | 280 °C (dec.)(lit.) | | storage temp. | room temp | | form | powder or crystals | | ε(extinction coefficient) | ≥75000 at 588-596nm in ethanol at 0.003g/L | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C23H23N2.HI/c1-3-24-15-13-18(20-9-5-7-11-22(20)24)17-19-14-16-25(4-2)23-12-8-6-10-21(19)23;/h5-17H,3-4H2,1-2H3;1H/q+1;/p-1 | | InChIKey | BFVPXROCOCTNOP-UHFFFAOYSA-M | | SMILES | [I-].CCN1C=CC(=Cc2cc[n+](CC)c3ccccc23)c4ccccc14 | | CAS DataBase Reference | 4727-49-5 |
| Hazard Codes | T | | Risk Statements | 23/24/25-36/37/38 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | 6.1(a) | | PackingGroup | II | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Eye Irrit. 2
Skin Irrit. 2 |
| | 1,1'-Diethyl-4,4'-cyanine iodide Usage And Synthesis |
| Uses | 1,1′-Diethyl-4,4′-cyanine Iodide is a quinocyanine dye.,1′-Diethyl-4,4′-cyanine Iodide is widely used as a photographic sensitizing dye. Dyes and metabolites. |
| | 1,1'-Diethyl-4,4'-cyanine iodide Preparation Products And Raw materials |
|