| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | trans,trans-9,11-Octadecadienoicacid Basic information |
| Product Name: | trans,trans-9,11-Octadecadienoicacid | | Synonyms: | Conjugated (9E,11E)-Linoleic acid
;JBYXPOFIGCOSSB-XBLVEGMJSA-N;Linoleicacid,conjugated=Isolinoleicacid,(9Z,11Z)-CLA;(9E,11E)-9,11-Octadecadienoic Acid;9,11-Octadecadienoic acid, (9E,11E)-;Trans-Linoleic Acid (C18:2 trans)/9(E),11(E)-Octadecadienoic acid;9(E),11(E)-Octadecadienoic acid, Conjugated linoleic acid;9(E),11(E)-Conjugated Linoleic Acid (Standard) | | CAS: | 544-71-8 | | MF: | C18H32O2 | | MW: | 280.45 | | EINECS: | | | Product Categories: | | | Mol File: | 544-71-8.mol |  |
| | trans,trans-9,11-Octadecadienoicacid Chemical Properties |
| storage temp. | -20°C | | solubility | Chloroform, Dichloromethane, Ethyl Acetate, Hexane | | color | White | | biological source | synthetic | | InChI | InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h7-10H,2-6,11-17H2,1H3,(H,19,20)/b8-7+,10-9+ | | InChIKey | JBYXPOFIGCOSSB-XBLVEGMJSA-N | | SMILES | C(O)(=O)CCCCCCC/C=C/C=C/CCCCCC |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | trans,trans-9,11-Octadecadienoicacid Usage And Synthesis |
| Description | 9(E),11(E)-Conjugated linoleic acid (9(E),11(E)-CLA) refers to a family of 8 geometric isomers of linoleic acid in which the two double bonds are contiguous. 9(E),11(E)-CLA is the 9,11 all-trans isomer of linoleic acid. CLA was originally identified in ground beef, but it is also present in a variety of dairy products. CLA is effective at reducing mammary tumors in rats at levels as low as 0.1% by weight of their diet. [Matreya, LLC. Catalog No. 1181] | | Uses | (9E,11E)-9,11-Octadecadienoic Acid is a by product during the synthesis of Rumenic Acid (R701590), a trans fatty acid that may potentially reduce the risk of cancer and cardiovascular diseases. It may also prevent disease processes that lead to chronic inflammation, atherosclerosis, and diabetes. | | Definition | ChEBI: 9E,11E-octadecadienoic acid is an octadeca-9,11-dienoic acid having 9-trans,11-trans-stereochemistry. It has a role as an apoptosis inducer, an antineoplastic agent, an anti-inflammatory agent, an antiatherogenic agent, a bacterial xenobiotic metabolite and a human metabolite. | | References | [1] Conjugated-linoleic-acid[J]. Reactions Weekly, 2021, 28 1: 137-137. DOI: 10.1007/s40278-021-06458-4 |
| | trans,trans-9,11-Octadecadienoicacid Preparation Products And Raw materials |
|