|
|
| | 3-BROMO-1,10-PHENANTHROLINE Basic information |
| | 3-BROMO-1,10-PHENANTHROLINE Chemical Properties |
| Melting point | 173 °C | | Boiling point | 397.8±22.0 °C(Predicted) | | density | 1.616 | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 4.22±0.10(Predicted) | | color | Light yellow to Brown | | InChI | InChI=1S/C12H7BrN2/c13-10-6-9-4-3-8-2-1-5-14-11(8)12(9)15-7-10/h1-7H | | InChIKey | OADZHFGJIVKDJN-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C3C=2N=CC=C3)C=C(Br)C=1 |
| Safety Statements | 24/25 | | HS Code | 29339900 |
| | 3-BROMO-1,10-PHENANTHROLINE Usage And Synthesis |
| | 3-BROMO-1,10-PHENANTHROLINE Preparation Products And Raw materials |
|