| Company Name: |
Wuhan ariel chemical Co., LTD.
|
| Tel: |
18986259541 18986259541 |
| Email: |
sales@3stc.com |
| Products Intro: |
Product Name:5-(4-Methoxy-phenyl)-2H-pyrazole-3-carboxylic acid methyl ester
CAS:192701-83-0
Purity:95%+ Package:5g 10g 100g 1kg
|
| Company Name: |
Wuhan Kaymke Chemical Co., Ltd.,
|
| Tel: |
027-87342388 18086026008 |
| Email: |
sales@kaymke.com |
| Products Intro: |
Product Name:METHYL 3-(4-METHOXYPHENYL)-1H-PYRAZOLE-5-CARBOXYLATE
CAS:192701-83-0
Purity:96% Package:1g.5g.10g.25g Remarks:16.3g
|
| Company Name: |
Zhengzhou Guancheng Laboratory equipment Sales
|
| Tel: |
0371-88888888 272369594 |
| Email: |
2723695949@qq.com |
| Products Intro: |
Product Name:5-(4-methoxyphenyl)-1H-Pyrazole-3-carboxylic acid methyl ester
CAS:192701-83-0
Package:97%
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-58851090 15955137747 |
| Email: |
sales01@aikonchem.com |
| Products Intro: |
Product Name:Methyl 3-(4-methoxyphenyl)-1H-pyrazole-5-carboxylate
CAS:192701-83-0
Purity:95+% Package:1g;5g;10g
|
|
| | 5-(4-Methoxy-phenyl)-2H-pyrazole-3-carboxylic acid methyl ester Basic information |
| Product Name: | 5-(4-Methoxy-phenyl)-2H-pyrazole-3-carboxylic acid methyl ester | | Synonyms: | 5-(4-methoxyphenyl)-1H-Pyrazole-3-carboxylic acid methyl ester;Methyl 3-(4-methoxyphenyl)-1H-pyrazole-5-carboxylate;Methyl 5-(4-methoxyphenyl)-1h-pyrazole-3-carboxylate;1H-Pyrazole-3-carboxylic acid, 5-(4-methoxyphenyl)-, methyl ester;Methyl 3-(4-methoxyphenyl)-1H-pyrazole-5-carboxylate | | CAS: | 192701-83-0 | | MF: | C12H12N2O3 | | MW: | 232.24 | | EINECS: | | | Product Categories: | | | Mol File: | 192701-83-0.mol |  |
| | 5-(4-Methoxy-phenyl)-2H-pyrazole-3-carboxylic acid methyl ester Chemical Properties |
| Boiling point | 451.9±40.0 °C(Predicted) | | density | 1.234±0.06 g/cm3(Predicted) | | form | solid | | pka | 10+-.0.10(Predicted) | | InChI | 1S/C12H12N2O3/c1-16-9-5-3-8(4-6-9)10-7-11(14-13-10)12(15)17-2/h3-7H,1-2H3,(H,13,14) | | InChIKey | FJNMXQMHEIWMQI-UHFFFAOYSA-N | | SMILES | COc1ccc(cc1)-c2cc([nH]n2)C(=O)OC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 5-(4-Methoxy-phenyl)-2H-pyrazole-3-carboxylic acid methyl ester Usage And Synthesis |
| | 5-(4-Methoxy-phenyl)-2H-pyrazole-3-carboxylic acid methyl ester Preparation Products And Raw materials |
|