| Company Name: |
Struchem Co., Ltd. Gold |
| Tel: |
0512-63009836 18994340901 |
| Email: |
helen@struchem.com |
Methyl 3-butynoate manufacturers
- Methyl 3-butynoate
-
- $1.00
-
2024-08-02
- CAS:32804-66-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
|
| | Methyl 3-butynoate Basic information |
| Product Name: | Methyl 3-butynoate | | Synonyms: | Methyl 2-Methylbut-3-ynoate;3-Butynoic acid, methyl ester (6CI, 8CI, 9CI, ACI);Methyl but-3-ynoate | | CAS: | 32804-66-3 | | MF: | C5H6O2 | | MW: | 98.1 | | EINECS: | | | Product Categories: | | | Mol File: | 32804-66-3.mol |  |
| | Methyl 3-butynoate Chemical Properties |
| Boiling point | 59-61 °C(Press: 50 Torr) | | density | 0.997±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C5H6O2/c1-3-4-5(6)7-2/h1H,4H2,2H3 | | InChIKey | JGEGAAGXXWDCOJ-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CC#C |
| | Methyl 3-butynoate Usage And Synthesis |
| Uses | Methyl But-3-ynoate is used in preparation of phenylalanine derivatives as non-peptide GLP-1 receptor agonists and sensitizers. |
| | Methyl 3-butynoate Preparation Products And Raw materials |
|