|
|
| | (Z)-2-(Methoxycarbonylmethoxyimino)-2-(2-aminothiazol-4-yl)acetic acid Basic information |
| Product Name: | (Z)-2-(Methoxycarbonylmethoxyimino)-2-(2-aminothiazol-4-yl)acetic acid | | Synonyms: | NICA;(Z)-2-Amino-ALPHA-[(2-methoxy-2-oxoethoxy)-imino]-4-thiazoleacetic acid;MICAAcid;(Z)-2-(2-AMINOTHIAZOL-4-YL)-2-METHOXYCARBONYLMETHOXYIMINOACETIC ACID;(Z)-2-(Methoxycarbonylmethoxyimino)-2-(2-aminothiazol-4-yl)acetic acid;(Z)-2-(2-METHOXY-2-OXOETHOXYIMINO)-2-(2-METHYLTHIAZOL-4-YL)ACETIC ACID;(Z)-(2-Aminothiazol-4-yl)-;(Z)-2-(2-AMinothiazol-4-yl)-2-((2-Methoxy-2-oxoethoxy)iMino)acetic acid | | CAS: | 80544-17-8 | | MF: | C8H9N3O5S | | MW: | 259.24 | | EINECS: | | | Product Categories: | | | Mol File: | 80544-17-8.mol |  |
| | (Z)-2-(Methoxycarbonylmethoxyimino)-2-(2-aminothiazol-4-yl)acetic acid Chemical Properties |
| Melting point | >160°C (dec.) | | Boiling point | 481.1±51.0 °C(Predicted) | | density | 1+-.0.1 g/cm3(Predicted) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | pka | 2.40±0.10(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C8H9N3O5S/c1-15-5(12)2-16-11-6(7(13)14)4-3-17-8(9)10-4/h3H,2H2,1H3,(H2,9,10)(H,13,14)/b11-6- | | InChIKey | AGFYEFQBXHONNW-WDZFZDKYSA-N | | SMILES | C(O)(=O)/C(/C1=CSC(N)=N1)=N\OCC(OC)=O |
| | (Z)-2-(Methoxycarbonylmethoxyimino)-2-(2-aminothiazol-4-yl)acetic acid Usage And Synthesis |
| Uses | (Z)-2-(2-amino-4-thiazolyl)-2-methoxycarbonylmethoxyiminoacetic acid (cefixime side chain acid) is an important side chain for the synthesis of the third and fourth generation cephalosporins It is of great economic and practical value to strengthen its research and development. | | Uses | (Z)-2-(Methoxycarbonylmethoxyimino)-2-(2-aminothiazol-4-yl)acetic acid can be used as an intermediate in organic synthesis. | | Preparation | The synthesis of cefixime side chain acid takes tert-butyl acetoacetate as raw material, through the steps of oximation, etherification, chlorination, cyclization and hydrolysis, to synthesize (Z)-2-(2-amino Thiazol-4-yl)-2-methoxycarbonylmethoxyiminoacetic acid. |
| | (Z)-2-(Methoxycarbonylmethoxyimino)-2-(2-aminothiazol-4-yl)acetic acid Preparation Products And Raw materials |
|