DIPHENYLTIN DICHLORIDE manufacturers
- NSC405640
-
- $1520.00
-
2026-04-20
- CAS:1135-99-5
- Purity:
- Supply Ability: 10g
|
| | DIPHENYLTIN DICHLORIDE Basic information |
| | DIPHENYLTIN DICHLORIDE Chemical Properties |
| Melting point | 41-43 °C (lit.) | | Boiling point | 333-337 °C (lit.) | | Fp | >230 °F | | solubility | Sparingly Soluble (2.4E-3 g/L) (25°C), Calc. | | form | Crystalline | | color | White | | Sensitive | Moisture Sensitive | | Exposure limits | ACGIH: TWA 0.1 mg/m3; STEL 0.2 mg/m3 (Skin) NIOSH: IDLH 25 mg/m3; TWA 0.1 mg/m3 | | Stability: | Hygroscopic | | InChI | 1S/2C6H5.2ClH.Sn/c2*1-2-4-6-5-3-1;;;/h2*1-5H;2*1H;/q;;;;+2/p-2 | | InChIKey | ISXUHJXWYNONDI-UHFFFAOYSA-L | | SMILES | Cl[Sn](Cl)(c1ccccc1)c2ccccc2 | | CAS DataBase Reference | 1135-99-5(CAS DataBase Reference) | | EPA Substance Registry System | Stannane, dichlorodiphenyl- (1135-99-5) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39 | | RIDADR | UN 3146 6.1/PG 3 | | WGK Germany | 3 | | RTECS | WH7253000 | | TSCA | No | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29319090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | DIPHENYLTIN DICHLORIDE Usage And Synthesis |
| Chemical Properties | white to off-white crystalline powder | | Uses | Used in the manufacture of chemicals. |
| | DIPHENYLTIN DICHLORIDE Preparation Products And Raw materials |
|