|
|
| | Bis(2,4-dinitrophenyl) oxalate Basic information |
| Product Name: | Bis(2,4-dinitrophenyl) oxalate | | Synonyms: | OXALIC ACID BIS(2,4-DINITROPHENYL) ESTER;2,4-DINITROPHENYL OXALATE;2,4-Dinitrophenyl oxalate, DNPO, Oxalic acid bis(2,4-dinitrophenyl) ester;Bis(2,4-dinitrophenyl) Oxalate [Chemiluminescence reagent for the determination of fluorescent compounds by HPLC and FIA];Ethanedioic acid,1,2-bis(2,4-dinitrophenyl) ester;Bis(2,4-dinitrophenyl) oxalate 98%;DNPO
Oxalic Acid Bis(2,4-dinitrophenyl) Ester;Bis(2,4-dinitrophenyl) Oxalate [Chemiluminescence reagent for the determination of fluorescent compounds by HPLC and FIA]> | | CAS: | 16536-30-4 | | MF: | C14H6N4O12 | | MW: | 422.22 | | EINECS: | | | Product Categories: | Analytical Chemistry;Chemiluminescence;Oxalates (Chemiluminescence) | | Mol File: | 16536-30-4.mol |  |
| | Bis(2,4-dinitrophenyl) oxalate Chemical Properties |
| Melting point | 189-190 °C(lit.) | | Boiling point | 605.1±55.0 °C(Predicted) | | density | 1.759±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | soluble in Benzene,Toluene | | form | powder to crystal | | color | White to Light yellow | | Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. | | InChI | 1S/C14H6N4O12/c19-13(29-11-3-1-7(15(21)22)5-9(11)17(25)26)14(20)30-12-4-2-8(16(23)24)6-10(12)18(27)28/h1-6H | | InChIKey | CBZOGAWUNMFXFQ-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc(OC(=O)C(=O)Oc2ccc(cc2[N+]([O-])=O)[N+]([O-])=O)c(c1)[N+]([O-])=O | | CAS DataBase Reference | 16536-30-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 1325 4.1/PG II | | WGK Germany | 3 | | F | 8-10-21 | | HS Code | 2914.50.5000 | | HazardClass | 4.1 | | PackingGroup | II | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Bis(2,4-dinitrophenyl) oxalate Usage And Synthesis |
| Chemical Properties | light yellow powder | | Uses | Bis(2,4-dinitrophenyl) oxalate was used in detection of fluorescent compound dansylalanine in buffer solution by flow injection analysis. | | General Description | Bis(2,4-dinitrophenyl) oxalate (DNPO) is a chemiluminescence reagent. Chemiluminescence produced in the oxidation of DNPO by hydrogen peroxide in the presence of a polycyclic aromatic hydrocarbon was monitored by spectroscopic methods. The kinetics of the imidazole-catalyzed decomposition of DNPO was investigated by the stopped-flow technique. |
| | Bis(2,4-dinitrophenyl) oxalate Preparation Products And Raw materials |
|