|
|
| | CODEINONE Basic information |
| Product Name: | CODEINONE | | Synonyms: | CODEINONE;6-codeinone;7,8-didehydro-4,5-alpha-epoxy-3-methoxy-17-methyl-morphinan-6-on;(5alpha)-7,8-didehydro-4,5-epoxy-3-methoxy-17-methylmorphinan-6-one;(5a)-7,8-Didehydro-4,5-epoxy-3-methoxy-17-methyl-morphinan-6-one;6-Oxocodeine;7,8-Didehydro-4,5a-epoxy-3-methoxy-17-methyl-morphinan-6-one;(5R)-3-Methoxy-7,8-didehydro-4,5-epoxy-17-methylmorphinan-6-one | | CAS: | 467-13-0 | | MF: | C18H19NO3 | | MW: | 297.35 | | EINECS: | 207-386-1 | | Product Categories: | Pharmaceuticals;Glucuronides;Intermediates & Fine Chemicals;Metabolites & Impurities | | Mol File: | 467-13-0.mol |  |
| | CODEINONE Chemical Properties |
| Melting point | 182-183°C | | Boiling point | 466.9±45.0 °C(Predicted) | | density | 1.34±0.1 g/cm3(Predicted) | | storage temp. | Controlled Substance, -20°C Freezer | | solubility | DMF: 20 mg/ml; DMF:PBS (pH 7.2) (1:1): 0.5 mg/ml; DMSO: 10 mg/ml | | form | A crystalline solid | | pka | 8.10±0.20(Predicted) | | Major Application | pharmaceutical | | InChI | 1S/C18H19NO3/c1-19-8-7-18-11-4-5-13(20)17(18)22-16-14(21-2)6-3-10(15(16)18)9-12(11)19/h3-6,11-12,17H,7-9H2,1-2H3/t11-,12+,17-,18-/m0/s1 | | InChIKey | XYYVYLMBEZUESM-CMKMFDCUSA-N | | SMILES | N1([C@H]2[C@H]3[C@@]4([C@@H](Oc5c4c(ccc5OC)C2)C(=O)C=C3)CC1)C | | CAS DataBase Reference | 467-13-0 |
| Risk Statements | 22 | | WGK Germany | WGK 3 | | HS Code | 2939190000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
STOT SE 3 |
| | CODEINONE Usage And Synthesis |
| Chemical Properties | Brown Solid | | Uses | A metabolite of Codeine. Controlled substance | | Uses | A metabolite of Codeine (C634075). Controlled substance. | | Definition | ChEBI: Codeinone is an isoquinoline alkaloid. It is functionally related to a morphine. It is a conjugate base of a codeinone(1+). |
| | CODEINONE Preparation Products And Raw materials |
|