| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | L-N-Butylsulfonyl-p-hydroxyphenylalanine Basic information |
| Product Name: | L-N-Butylsulfonyl-p-hydroxyphenylalanine | | Synonyms: | (S)-2-(Butylsulfonamido)-3-(4-hydroxyphenyl)propanoic acid;L-N-butylsulfonyl-P-hydroxyamphetamine;Debutylpiperidine Tirofiban;(S)-2-(N-(4-hydroxyphenyl)butylsulfonamido)propanoic acid;-2-(Butylsulfonamido);N-(BUTANE-1-SULFONYL)-L-TYROSINE;L-Tyrosine, N-(butylsulfonyl)-;Tirofiban Hydrochloride Impurity A | | CAS: | 149490-60-8 | | MF: | C13H19NO5S | | MW: | 301.36 | | EINECS: | 675-711-8 | | Product Categories: | | | Mol File: | 149490-60-8.mol |  |
| | L-N-Butylsulfonyl-p-hydroxyphenylalanine Chemical Properties |
| Melting point | 121-124oC | | Boiling point | 519.6±60.0 °C(Predicted) | | density | 1.321±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Aqueous Acid (Sparingly), Methanol (Slightly) | | pka | 3.39±0.10(Predicted) | | form | Solid | | color | Off-White to Pale Yellow | | InChI | InChI=1S/C13H19NO5S/c1-2-3-8-20(18,19)14-12(13(16)17)9-10-4-6-11(15)7-5-10/h4-7,12,14-15H,2-3,8-9H2,1H3,(H,16,17)/t12-/m0/s1 | | InChIKey | VCKJOKXXEIQENI-LBPRGKRZSA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=C(O)C=C1)NS(CCCC)(=O)=O |
| | L-N-Butylsulfonyl-p-hydroxyphenylalanine Usage And Synthesis |
| Uses | Debutylpiperidine Tirofiban is an intermediate in the synthesis of Tirofiban-d6, the labeled analogue of Tirofiban (T446750), a specific nonpeptide platelet fibrinogen receptor (GPIIb/IIIa) antagonist. Tirofiban is an antithrombotic used in the treatment of unstable angina. |
| | L-N-Butylsulfonyl-p-hydroxyphenylalanine Preparation Products And Raw materials |
|