|
|
| | 1,5-DIMETHYL-2-PYRROLECARBONITRILE Basic information |
| Product Name: | 1,5-DIMETHYL-2-PYRROLECARBONITRILE | | Synonyms: | 1,5-DIMETHYL-2-PYRROLECARBONITRILE;1,5-dimethylpyrrole-2-carbonitrile;1H-Pyrrole-2-carbonitrile,1,5-dimethyl-(9CI);1,5-DIMETHYL-2-PYRROLECARBONITRILE 99%;1,5-Dimethyl-2-pyrrolecarbonitrile,99%;1H-Pyrrole-2-carbonitrile,1,5-dimethyl-;InChI=1/C7H8N2/c1-6-3-4-7(5-8)9(6)2/h3-4H,1-2H;TIMTEC-BB SBB007580 | | CAS: | 56341-36-7 | | MF: | C7H8N2 | | MW: | 120.15 | | EINECS: | 260-120-6 | | Product Categories: | AMINETERTIARY;Building Blocks;Heterocyclic Building Blocks;Pyrroles | | Mol File: | 56341-36-7.mol |  |
| | 1,5-DIMETHYL-2-PYRROLECARBONITRILE Chemical Properties |
| Melting point | 54-56 °C (lit.) | | Boiling point | 214.16°C (rough estimate) | | density | 1.0726 (rough estimate) | | refractive index | 1.5103 (estimate) | | Fp | 220 °F | | storage temp. | 2-8°C | | pka | -7.99±0.70(Predicted) | | form | Crystalline Powder | | color | Brown-gray | | InChI | 1S/C7H8N2/c1-6-3-4-7(5-8)9(6)2/h3-4H,1-2H3 | | InChIKey | DRXOPQFEWDRGKT-UHFFFAOYSA-N | | SMILES | Cc1ccc(C#N)n1C | | CAS DataBase Reference | 56341-36-7 |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36 | | WGK Germany | 3 | | HS Code | 29339980 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral |
| | 1,5-DIMETHYL-2-PYRROLECARBONITRILE Usage And Synthesis |
| Chemical Properties | brown-grey crystalline powder | | Uses | 1,5-Dimethyl-1H-pyrrole-2-carbonitrile can be used as pro-apoptotic and antitumor agents. | | Definition | ChEBI: 1,5-Dimethyl-1H-pyrrole-2-carbonitrile is a member of pyrroles. | | General Description | The standard molar enthalpy of formation of 1,5-dimethyl-2-pyrrolecarbonitrile in the gaseous phase was studied. |
| | 1,5-DIMETHYL-2-PYRROLECARBONITRILE Preparation Products And Raw materials |
|