| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Dibenzyl 2,2'-iminobis(ethylcarbamate) Basic information |
| Product Name: | Dibenzyl 2,2'-iminobis(ethylcarbamate) | | Synonyms: | CAS_160256-75-7;N,N''-DI-BENZYLOXYCARBONYL-DIETHYLENETRIAMINE;N,N''-DI-Z-DIETHYLENETRIAMINE;Z-EDA-EDA-Z;N,N''-Di-Z-diethylenetriamine≥ 97% (HPLC);10-Oxa-2,5,8-triazaundecanoic acid, 9-oxo-11-phenyl-, phenylmethyl ester;benzyl N-[2-[2-(phenylmethoxycarbonylamino)ethylamino]ethyl]carbamate;N1-Cbz-N2-[2-(Cbz-amino)ethyl]ethane-1,2-diamine | | CAS: | 160256-75-7 | | MF: | C20H25N3O4 | | MW: | 371.43 | | EINECS: | | | Product Categories: | | | Mol File: | 160256-75-7.mol |  |
| | Dibenzyl 2,2'-iminobis(ethylcarbamate) Chemical Properties |
| Melting point | 70-74 °C | | Boiling point | 581.773±50.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.178±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 12.067±0.46(predicted) | | Appearance | White to off-white Solid | | BRN | 7083538 | | InChI | 1S/C20H25N3O4/c24-19(26-15-17-7-3-1-4-8-17)22-13-11-21-12-14-23-20(25)27-16-18-9-5-2-6-10-18/h1-10,21H,11-16H2,(H,22,24)(H,23,25) | | InChIKey | DWPBEWIGNADCAX-UHFFFAOYSA-N | | SMILES | O=C(NCCNCCNC(=O)OCc1ccccc1)OCc2ccccc2 |
| Hazard Codes | Xi,N | | Risk Statements | 37/38-41-50 | | Safety Statements | 26-39-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | Dibenzyl 2,2'-iminobis(ethylcarbamate) Usage And Synthesis |
| Chemical Properties | Off-white solid | | Uses | Building block to introduce e.g. a protected 2,2'-iminodi(ethylamine) scaffold in libraries. | | reaction suitability | reagent type: cross-linking reagent |
| | Dibenzyl 2,2'-iminobis(ethylcarbamate) Preparation Products And Raw materials |
|