| Company Name: |
Hangzhou Copiore Chemical Co., Ltd. Gold
|
| Tel: |
17300981287 13757145729 |
| Email: |
sales@copiore.com |
| Products Intro: |
Product Name:5-Chloro-2,4-difluoropyrimidine
CAS:25151-07-9
Purity:98% Package:1kg;5kg;25kg
|
|
| | 5-chloro-2,4-difluoropyrimidine Basic information |
| | 5-chloro-2,4-difluoropyrimidine Chemical Properties |
| Boiling point | 250.6±43.0 °C(Predicted) | | density | 1.563±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -3.94±0.29(Predicted) | | form | liquid | | color | Colourless | | InChI | InChI=1S/C4HClF2N2/c5-2-1-8-4(7)9-3(2)6/h1H | | InChIKey | XZSZSTCLQANXKU-UHFFFAOYSA-N | | SMILES | C1(F)=NC=C(Cl)C(F)=N1 |
| HazardClass | IRRITANT | | HS Code | 2920907090 |
| | 5-chloro-2,4-difluoropyrimidine Usage And Synthesis |
| Uses | 5-Chloro-2,4-difluoropyrimidine is a synthetic intermediate in various synthesis of pharmaceutical goods. |
| | 5-chloro-2,4-difluoropyrimidine Preparation Products And Raw materials |
|