| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | 2,3-Diphospho-D-glyceric acid pentasodium salt Basic information |
| Product Name: | 2,3-Diphospho-D-glyceric acid pentasodium salt | | Synonyms: | 2,3-DIPHOSPHO-D-GLYCERIC ACID PENTAS;pentasodium:(2R)-2,3-diphosphonatooxypropanoate;2-3-DIPHOSPHO-D-GLYCERIC ACID*PENTASODIU M;d-glycerate 2,3-diphosphate sodium salt;sodiuM 2,3-bis(phosphonatooxy)propanoate;Propanoic acid,2,3-bis(phosphonooxy)-, pentasodium salt, (2R)- (9CI);2,3-Diphospho-D-glyceric acid pentasodium salt glycolysis metabolite;2,3-Diphospho-D-glycericacidpentasodiumsal | | CAS: | 102783-53-9 | | MF: | C3H3Na5O10P2 | | MW: | 375.95 | | EINECS: | | | Product Categories: | | | Mol File: | 102783-53-9.mol |  |
| | 2,3-Diphospho-D-glyceric acid pentasodium salt Chemical Properties |
| storage temp. | -20°C | | solubility | Water; DMSO; | | form | Solid | | color | Off-white to light yellow | | biological source | synthetic | | Water Solubility | water: 100mg/mL, clear, colorless to faintly yellow | | InChI | 1S/C3H8O10P2.Na.H/c4-3(5)2(13-15(9,10)11)1-12-14(6,7)8;;/h2H,1H2,(H,4,5)(H2,6,7,8)(H2,9,10,11);;/t2-;;/m1../s1 | | InChIKey | JJEMSNINYKJOBZ-YBBRRFGFSA-N | | SMILES | [Na].OC(=O)[C@@H](COP(O)(O)=O)OP(O)(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 2,3-Diphospho-D-glyceric acid pentasodium salt Usage And Synthesis |
| Uses | D-Glycerate 2,3-diphosphate, cofactor of both phosphoglyceric acid mutase and hemoglobin, may be used as a reference compound in analysis of blood cell (erythrocyte) glycolysic cycle metabolites. | | Biochem/physiol Actions | Metabolite of glycolysis within human erythrocytes produced by 2,3-diphosphoglycerate mutase in an alternative to the glycolytic pathway. Binds to hemaglobin to reduce oxygenation. |
| | 2,3-Diphospho-D-glyceric acid pentasodium salt Preparation Products And Raw materials |
|