| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
1-Pyrenylmethyl methacrylate manufacturers
|
| | 1-Pyrenylmethyl methacrylate Basic information |
| | 1-Pyrenylmethyl methacrylate Chemical Properties |
| Melting point | 101-103°C | | Boiling point | 472.2±14.0 °C(Predicted) | | density | 1.237±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Ethyl Acetate (Slightly) | | form | powder | | Appearance | Off-White to Pale Yellow Solid | | InChI | InChI=1S/C21H16O2/c1-13(2)21(22)23-12-17-9-8-16-7-6-14-4-3-5-15-10-11-18(17)20(16)19(14)15/h3-11H,1,12H2,2H3 | | InChIKey | BUQDPCFXOBQDLX-UHFFFAOYSA-N | | SMILES | C(OCC1=C2C3=C4C(C=C2)=CC=CC4=CC=C3C=C1)(=O)C(C)=C | | CAS DataBase Reference | 86112-79-0 |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 |
| | 1-Pyrenylmethyl methacrylate Usage And Synthesis |
| Description | (1-Pyrene)methyl Methacrylate is a fluorescent monomer. | | Chemical Properties | White to Off-White Solid | | Uses | A fluorescent labelled monomer | | Uses | | | General Description | 1-Pyrenemethyl methacrylate is a fluorescent methacrylate monomer which is used for synthesising poly methyl methacrylate (PMMA) based optical and fluorescent temperature sensors. These polymeric sensors exhibit reverse solubility transition wherein the polymer is insoluble at low temperatures and is soluble at higher temperatures. These sensors are used as biosensors, in drug delivery, logical gates and optical sensing applications. |
| | 1-Pyrenylmethyl methacrylate Preparation Products And Raw materials |
|