|
|
| | (E)-Oct-4-ene-1,8-dioic acid Basic information |
| Product Name: | (E)-Oct-4-ene-1,8-dioic acid | | Synonyms: | E-Oct-4-ene-1,8-dioicacid;4-Octenedioic acid,(4E)-;trans-4-octene-1,8-dioic acid;Mivacurium Chloride intermediate;(4E)-4-Octenedioic acid;(E)-Oct-4-ene-1,8-dioicaci;(E)-Oct-4-enedioic acid;Mivacurium chloride Impurity 49 | | CAS: | 48059-97-8 | | MF: | C8H12O4 | | MW: | 172.18 | | EINECS: | | | Product Categories: | 1 | | Mol File: | 48059-97-8.mol |  |
| | (E)-Oct-4-ene-1,8-dioic acid Chemical Properties |
| Melting point | 175-176 °C | | Boiling point | 373.1±30.0 °C(Predicted) | | density | 1.200±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | solubility | DMSO (Slightly), Methanol (Very Slightly) | | form | Solid | | pka | 4.27±0.10(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C8H12O4/c9-7(10)5-3-1-2-4-6-8(11)12/h1-2H,3-6H2,(H,9,10)(H,11,12)/b2-1+ | | InChIKey | LQVYKEXVMZXOAH-OWOJBTEDSA-N | | SMILES | C(O)(=O)CC/C=C/CCC(O)=O |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 3
Eye Irrit. 2 |
| | (E)-Oct-4-ene-1,8-dioic acid Usage And Synthesis |
| Uses | (E)-Oct-4-ene-1,8-dioic acid is an organic compound that belongs to the
group of metathesis reactions. It is a skeleton for many macrocycles and
stereoselectivity can be achieved through this reaction. |
| | (E)-Oct-4-ene-1,8-dioic acid Preparation Products And Raw materials |
|