|
|
| | (2,3-dihydroxy-4-oxo-pentoxy)phosphonic acid Basic information |
| Product Name: | (2,3-dihydroxy-4-oxo-pentoxy)phosphonic acid | | Synonyms: | (2,3-dihydroxy-4-oxo-pentoxy)phosphonic acid;1-Deoxy-D-xylulose-5-phosphate sodium salt;1-Deoxy-D-xylulose 5-phosphate (DXP);D-threo-2-Pentulose, 1-deoxy-, 5-(dihydrogen phosphate);1-Deoxy-D-xylulose 5-phosphate | | CAS: | 190079-18-6 | | MF: | C5H11O7P | | MW: | 214.11 | | EINECS: | | | Product Categories: | | | Mol File: | 190079-18-6.mol |  |
| | (2,3-dihydroxy-4-oxo-pentoxy)phosphonic acid Chemical Properties |
| Boiling point | 528.9±60.0 °C(Predicted) | | density | 1.653±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | form | powder | | pka | 1.82±0.10(Predicted) | | color | white | | Optical Rotation | [α]/D 37.0±3.0°, c = 0.1 in 0.1 M HCl | | BRN | 8367371 | | InChI | 1S/C5H11O7P/c1-3(6)5(8)4(7)2-12-13(9,10)11/h4-5,7-8H,2H2,1H3,(H2,9,10,11)/t4-,5-/m1/s1 | | InChIKey | AJPADPZSRRUGHI-RFZPGFLSSA-N | | SMILES | [P](=O)(OC[C@@H](O)[C@H](O)C(=O)C)(O)O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (2,3-dihydroxy-4-oxo-pentoxy)phosphonic acid Usage And Synthesis |
| Uses | 1-Deoxy-D-xylulose 5-Phosphate is a precursor metabolite of the 2C-Methyl-D-erythritol-4-phosphate (MEP) pathway, from the simple and renewable starting materials D-arabinose and hydroxyacetone. | | Definition | ChEBI: 1-deoxy-D-xylulose 5-phosphate is the 5-phospho derivative of 1-deoxy-D-xylulose. It has a role as an Escherichia coli metabolite. It is functionally related to a D-xylulose. It is a conjugate acid of a 1-deoxy-D-xylulose 5-phosphate(2-). |
| | (2,3-dihydroxy-4-oxo-pentoxy)phosphonic acid Preparation Products And Raw materials |
|