|
|
| | 4R,6R-Dorzolamide Basic information |
| Product Name: | 4R,6R-Dorzolamide | | Synonyms: | (4R,6R)-4-(Ethylamino)-5,6-dihydro-6-methyl-4H-thieno[2,3-b]thiopyran-2-sulfonamide-7,7-dioxide;(4R,6R)-4-(Ethylamino)-6-methyl-5,6-dihydro-4H-thieno[2, 3-b]thiopyran-2-sulfonamide 7,7-dioxide HCl;4H-Thieno[2,3-b]thiopyran-2-sulfonamide, 4-(ethylamino)-5,6-dihydro-6-methyl-, 7,7-dioxide, (4R,6R)-;4H-Thieno[2,3-b]thiopyran-2-sulfonamide, 4-(ethylamino)-5,6-dihydro-6-methyl-, 7,7-dioxide, (4R-trans)-;4R,6R-Dorzolamide;ent-DorzolaMide;Dorzolamide EP Imp A;Dorzolamide impurity A CRS | | CAS: | 120279-95-0 | | MF: | C10H16N2O4S3 | | MW: | 324.44 | | EINECS: | | | Product Categories: | Chiral Reagents, Heterocycles, Impurities, Pharmaceuticals, Intermediates & Fine Chemicals, Sulfur & Selenium Compounds | | Mol File: | 120279-95-0.mol |  |
| | 4R,6R-Dorzolamide Chemical Properties |
| Melting point | 283-285 °C | | Boiling point | 575.8±60.0 °C(Predicted) | | density | 1.53±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 9.48±0.60(Predicted) | | color | White to Off-White | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C10H16N2O4S3/c1-3-12-8-4-6(2)18(13,14)10-7(8)5-9(17-10)19(11,15)16/h5-6,8,12H,3-4H2,1-2H3,(H2,11,15,16)/t6-,8-/m1/s1 | | InChIKey | IAVUPMFITXYVAF-HTRCEHHLSA-N | | SMILES | CCN[C@@H]1C[C@@H](C)S(=O)(=O)c2sc(cc12)S(N)(=O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4R,6R-Dorzolamide Usage And Synthesis |
| Uses | ent-Dorzolamide is an enantiomer of Dorzolamide (D535100), an carbonic anhydrase inhibitor and antiglaucoma agent. | | Uses | ent-Dorzolamide (Dorzolamide EP Impurity A) is an enantiomer of Dorzolamide (D535100), an carbonic anhydrase inhibitor and antiglaucoma agent. |
| | 4R,6R-Dorzolamide Preparation Products And Raw materials |
|