3-Isoxazolecarboxylicacid,4-methyl-,ethylester(9CI) manufacturers
|
| | 3-Isoxazolecarboxylicacid,4-methyl-,ethylester(9CI) Basic information |
| Product Name: | 3-Isoxazolecarboxylicacid,4-methyl-,ethylester(9CI) | | Synonyms: | 3-Isoxazolecarboxylicacid,4-methyl-,ethylester(9CI);ethyl 4-methylisoxazole-3-carboxylate;4-methyl-3-Isoxazolecarboxylic acid ethyl ester;4-Methyl-isoxazole-3-carboxylic acid ethyl ester;3-Isoxazolecarboxylic acid, 4-methyl-, ethyl ester;ethyl 4-methyl-1,2-oxazole-3-carboxylate | | CAS: | 38061-69-7 | | MF: | C7H9NO3 | | MW: | 155.15 | | EINECS: | | | Product Categories: | OXAZOLE | | Mol File: | 38061-69-7.mol |  |
| | 3-Isoxazolecarboxylicacid,4-methyl-,ethylester(9CI) Chemical Properties |
| Melting point | 50.5-52.5 °C | | Boiling point | 230.1±20.0 °C(Predicted) | | density | 1.139±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | -5.08±0.50(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C7H9NO3/c1-3-10-7(9)6-5(2)4-11-8-6/h4H,3H2,1-2H3 | | InChIKey | GLIAHNBDYLZILU-UHFFFAOYSA-N | | SMILES | O1C=C(C)C(C(OCC)=O)=N1 |
| | 3-Isoxazolecarboxylicacid,4-methyl-,ethylester(9CI) Usage And Synthesis |
| | 3-Isoxazolecarboxylicacid,4-methyl-,ethylester(9CI) Preparation Products And Raw materials |
|