| Company Name: |
Alta Scientific Co., Ltd. Gold
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Erbon
CAS:136-25-4
Purity:99% Package:10mg;100mg;1g
|
| Company Name: |
TianJin Alta Scientific Co., Ltd.
|
| Tel: |
022-65378550-8551 |
| Email: |
contact@altascientific.com |
| Products Intro: |
Product Name:Erbon
CAS:136-25-4
Purity:98% Package:10Mg 25Mg 100Mg
|
|
| Product Name: | ERBON | | Synonyms: | 2-(2,4,5-Trichlorfenoxy)ethylester kyseliny 2,2-dichlorpropionove;2-(2,4,5-trichlorfenoxy)ethylesterkyseliny2,2-dichlorpropionove;2-(2,4,5-Trichlorophenoxy)ethyl 2,2-dichloropropionate;2-(2,4,5-trichlorophenoxy)ethyl2,2-dichloropropionate;2-(2,4,5-trichlorophenoxy)ethyl2,2-dichloropropionate[qr];2,2-dichloropropanoicacid2-(2,4,5-trichlorophenoxy)ethylester;2,2-Dichloropropionic acid 2-(2,4,5-trichlorophenoxy)ethyl ester;2,2-dichloropropionicacid,2-(2,4,5-trichlorophenoxy)ethylester | | CAS: | 136-25-4 | | MF: | C11H9Cl5O3 | | MW: | 366.45 | | EINECS: | | | Product Categories: | | | Mol File: | 136-25-4.mol |  |
| | ERBON Chemical Properties |
| Melting point | 49-50° | | Boiling point | bp0.5 161-164° | | density | d450 1.55 | | refractive index | 1.5550 (estimate) | | InChI | InChI=1S/C11H9Cl5O3/c1-11(15,16)10(17)19-3-2-18-9-5-7(13)6(12)4-8(9)14/h4-5H,2-3H2,1H3 | | InChIKey | KMHZPJNVPCAUMN-UHFFFAOYSA-N | | SMILES | C(OCCOC1=CC(Cl)=C(Cl)C=C1Cl)(=O)C(Cl)(Cl)C | | EPA Substance Registry System | Erbon (136-25-4) |
| | ERBON Usage And Synthesis |
| Chemical Properties | Solid. Insoluble in water; soluble in most
organic solvents. | | Uses | Herbicide. | | Definition | ChEBI: Erbon is an aromatic ether. It has a role as a phenoxy herbicide. | | Production Methods | The commercial production process of erbon is not described in open literature. However, based on its structure its former commercial production would have followed the same strategy used for other chlorophenoxy esters: preparation of the 2,4,5 trichlorophenoxyethanol precursor, synthesis of the 2,2 dichloropropanoyl chloride or equivalent acylating reagent, and esterification under controlled conditions, followed by purification to technical grade. | | Hazard | Toxic by inhalation and ingestion, strong
irritant to eyes and skin. | | Mechanism of action | Selective action. Synthetic auxin with action like indole acetic acid | | Safety Profile | Moderately toxic by ingestion. Used as a herbicide to control perennial broadleaf weeds. When heated to decomposition it emits toxic fumes of Clí. | | Pesticide Type | Herbicide |
| | ERBON Preparation Products And Raw materials |
|