| Company Name: |
Alta Scientific Co., Ltd. Gold
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Erbon
CAS:136-25-4
Purity:99% Package:10mg;100mg;1g
|
| Company Name: |
TianJin Alta Scientific Co., Ltd.
|
| Tel: |
022-65378550-8551 |
| Email: |
contact@altascientific.com |
| Products Intro: |
Product Name:Erbon
CAS:136-25-4
Purity:98% Package:10Mg 25Mg 100Mg
|
|
| Product Name: | ERBON | | Synonyms: | 2-(2,4,5-Trichlorfenoxy)ethylester kyseliny 2,2-dichlorpropionove;2-(2,4,5-trichlorfenoxy)ethylesterkyseliny2,2-dichlorpropionove;2-(2,4,5-Trichlorophenoxy)ethyl 2,2-dichloropropionate;2-(2,4,5-trichlorophenoxy)ethyl2,2-dichloropropionate;2-(2,4,5-trichlorophenoxy)ethyl2,2-dichloropropionate[qr];2,2-dichloropropanoicacid2-(2,4,5-trichlorophenoxy)ethylester;2,2-Dichloropropionic acid 2-(2,4,5-trichlorophenoxy)ethyl ester;2,2-dichloropropionicacid,2-(2,4,5-trichlorophenoxy)ethylester | | CAS: | 136-25-4 | | MF: | C11H9Cl5O3 | | MW: | 366.45 | | EINECS: | | | Product Categories: | | | Mol File: | 136-25-4.mol |  |
| | ERBON Chemical Properties |
| Melting point | 49-50° | | Boiling point | bp0.5 161-164° | | density | d450 1.55 | | refractive index | 1.5550 (estimate) | | InChI | InChI=1S/C11H9Cl5O3/c1-11(15,16)10(17)19-3-2-18-9-5-7(13)6(12)4-8(9)14/h4-5H,2-3H2,1H3 | | InChIKey | KMHZPJNVPCAUMN-UHFFFAOYSA-N | | SMILES | C(OCCOC1=CC(Cl)=C(Cl)C=C1Cl)(=O)C(Cl)(Cl)C | | EPA Substance Registry System | Erbon (136-25-4) |
| | ERBON Usage And Synthesis |
| Chemical Properties | Solid. Insoluble in water; soluble in most
organic solvents. | | Uses | Herbicide. | | Definition | ChEBI: Erbon is an aromatic ether. It has a role as a phenoxy herbicide. | | Hazard | Toxic by inhalation and ingestion, strong
irritant to eyes and skin. | | Safety Profile | Moderately toxic by ingestion. Used as a herbicide to control perennial broadleaf weeds. When heated to decomposition it emits toxic fumes of Clí. |
| | ERBON Preparation Products And Raw materials |
|