3-(phenylamino)alanine manufacturers
|
| | 3-(phenylamino)alanine Basic information |
| Product Name: | 3-(phenylamino)alanine | | Synonyms: | 3-PHENYLAMINO-L-ALANINE;Tryptophan Impurity 4(Tryptophan EP Impurity F);Tryptophan Impurity 1;(2S)-2-amino-3-anilinopropanoic acid;L-Alanine, 3-(phenylamino)-;Des-(3-Indolyl) 3-(Phenylamino) Tryptophan;N-Acetyltryptophan EP Impurity F;(2S)-2-amino-3-(phenylamino)propanoic acid (3-phenylaminoalanine) | | CAS: | 145545-23-9 | | MF: | C9H12N2O2 | | MW: | 180.2 | | EINECS: | | | Product Categories: | | | Mol File: | 145545-23-9.mol |  |
| | 3-(phenylamino)alanine Chemical Properties |
| Boiling point | 406.7±40.0 °C(Predicted) | | density | 1.281±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 1.85±0.10(Predicted) | | Major Application | pharmaceutical | | InChI | 1S/C9H12N2O2/c10-8(9(12)13)6-11-7-4-2-1-3-5-7/h1-5,8,11H,6,10H2,(H,12,13)/t8-/m0/s1 | | InChIKey | HLZOBKHLQBRIJP-QMMMGPOBSA-N | | SMILES | N[C@@H](CNc1ccccc1)C(=O)O |
| WGK Germany | WGK 3 | | Storage Class | 13 - Non Combustible Solids |
| | 3-(phenylamino)alanine Usage And Synthesis |
| Uses | Des-(3-Indolyl) 3-(Phenylamino) Tryptophan is the impurity of Tryptophan (T947210), which is an essential amino acid. |
| | 3-(phenylamino)alanine Preparation Products And Raw materials |
|