| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,5-Dimethoxy-4-nitroaniline Basic information |
| Product Name: | 2,5-Dimethoxy-4-nitroaniline | | Synonyms: | TIMTEC-BB SBB000371;2,5-DIMETHOXY-4-NITROANILINE;2,5-DIMETHOXY-4-NITROBENZENAMINE;2,5-DIMETHOXY-4-NITROANILINE, 98+%;Benzenamine, 2,5-dimethoxy-4-nitro-;2,5-dimethoxy-4-nitro-benzenamin;2,5-Dimethoxy-4-nitroaniline>;2,5-Dimethoxy-4-nitroaniline ISO 9001：2015 REACH | | CAS: | 6313-37-7 | | MF: | C8H10N2O4 | | MW: | 198.18 | | EINECS: | 228-640-8 | | Product Categories: | Amines;C8;Nitrogen Compounds | | Mol File: | 6313-37-7.mol |  |
| | 2,5-Dimethoxy-4-nitroaniline Chemical Properties |
| Melting point | 152-155 °C (lit.) | | Boiling point | 335.48°C (rough estimate) | | density | 1.3764 (rough estimate) | | refractive index | 1.6180 (estimate) | | pka | 0.60±0.14(Predicted) | | form | Granular Crystalline Powder | | color | Dark khaki | | InChI | 1S/C8H10N2O4/c1-13-7-4-6(10(11)12)8(14-2)3-5(7)9/h3-4H,9H2,1-2H3 | | InChIKey | ZTQGTYFYOODGOQ-UHFFFAOYSA-N | | SMILES | COc1cc(c(OC)cc1N)[N+]([O-])=O | | CAS DataBase Reference | 6313-37-7(CAS DataBase Reference) | | EPA Substance Registry System | Benzenamine, 2,5-dimethoxy-4-nitro- (6313-37-7) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36-36/37 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29221985 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2,5-Dimethoxy-4-nitroaniline Usage And Synthesis |
| Chemical Properties | dark khaki granular crystalline powder | | Uses | 2,5-Dimethoxy-4-nitroaniline was used in screening of enzyme arylamine N-acetyltransferase isolated from Bacillus cereus. | | General Description | 2,5-Dimethoxy-4-nitroaniline was used in screening of enzyme arylamine N-acetyltransferase isolated from Bacillus cereus. |
| | 2,5-Dimethoxy-4-nitroaniline Preparation Products And Raw materials |
| Raw materials | 3,6-Dimethoxy-2-nitroaniline-->2',5'-dimethoxy-4'-nitrobenzanilide-->Acetamide, N-(2,5-dimethoxy-4-nitrophenyl)--->1,3-Bis(2,5-dimethoxyphenyl)urea-->N-(2,5-Dimethoxyphenyl) benzamide-->1,4-Dimethoxy-2-nitrobenzene-->2',5'-Dimethoxyacetanilide-->Pyridine | | Preparation Products | 2,5-Dimethoxy-4-chloroaniline-->Benzenediazonium, 2,5-dimethoxy-4-[[2-oxo-1-[(phenylamino)carbonyl]propyl]azo]--->N-(4-chloro-2,5-dimethoxyphenyl)acetamide |
|