- FDGLU
-
- $1.00
-
2019-07-06
- CAS:129787-66-2
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 100KG
|
| Product Name: | FDGLU | | Synonyms: | FDGLCA;FDGLCU;FDGLU;FLUORESCEIN DI-(BETA-D-GLUCOPYRANOSIDE);FLUORESCEIN DI-BETA-D-GLUCURONIDE;Fluorescein di-β-D-glucopyranoside ,95%;fluorescein di-(B-D-glucopyranoside);fluorescein di-(β-d-glucopyranoside) | | CAS: | 129787-66-2 | | MF: | C32H32O15 | | MW: | 656.59 | | EINECS: | 1533716-785-6 | | Product Categories: | | | Mol File: | 129787-66-2.mol |  |
| | FDGLU Chemical Properties |
| storage temp. | −20°C | | form | solid | | Appearance | Solid Powder | | BRN | 7455945 | | InChIKey | ZTOBILYWTYHOJB-LWXMCBIJSA-N | | SMILES | OC[C@H]1O[C@@H](Oc2ccc3c(Oc4cc(O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)ccc4C36OC(=O)c7ccccc67)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | HS Code | 29389090 | | Storage Class | 11 - Combustible Solids |
| | FDGLU Usage And Synthesis |
| Description | Fluorescein Di-β-D-Glucopyranoside is a fluorogenic substrate for measurement of β-glucosidase activity in vitro and in vivo. | | Chemical Properties | Off-white crystalline powder | | Uses | Fluoregenic β-glucosidase substare | | Uses | Fluorescein Di-(β-D-glucopyranoside) is an ultrasensitive fluorogenic substrate for measurement of β-glucosidase activity in vivo or in vitro. | | Excitation / Emission Maximum | 490 nm/514 nm |
| | FDGLU Preparation Products And Raw materials |
|