| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 6-Bromo-2-chloro-[1,8]naphthyridine Basic information |
| | 6-Bromo-2-chloro-[1,8]naphthyridine Chemical Properties |
| storage temp. | 2-8°C | | Appearance | Light brown to brown Solid | | InChI | InChI=1S/C8H4BrClN2/c9-6-3-5-1-2-7(10)12-8(5)11-4-6/h1-4H | | InChIKey | KXSBJEOTLVRREX-UHFFFAOYSA-N | | SMILES | N1C2C(=CC(Br)=CN=2)C=CC=1Cl |
| | 6-Bromo-2-chloro-[1,8]naphthyridine Usage And Synthesis |
| Uses | 6-Bromo-2-chloro-1,8-naphthyridine, is used as raw material for synthesis of pharmaceutical intermediates. |
| | 6-Bromo-2-chloro-[1,8]naphthyridine Preparation Products And Raw materials |
|