| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-(5-Ethyl-1,2,4-oxadiazol-3-yl)benzoic acid Basic information |
| | 3-(5-Ethyl-1,2,4-oxadiazol-3-yl)benzoic acid Chemical Properties |
| Boiling point | 431.8±47.0 °C(Predicted) | | density | 1.288±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 3.62±0.10(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C11H10N2O3/c1-2-9-12-10(13-16-9)7-4-3-5-8(6-7)11(14)15/h3-6H,2H2,1H3,(H,14,15) | | InChIKey | ZUEUZEBBRRWMHB-UHFFFAOYSA-N | | SMILES | CCC1=NC(C2=CC=CC(C(O)=O)=C2)=NO1 | | CAS DataBase Reference | 859155-81-0 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 3-(5-Ethyl-1,2,4-oxadiazol-3-yl)benzoic acid Usage And Synthesis |
| | 3-(5-Ethyl-1,2,4-oxadiazol-3-yl)benzoic acid Preparation Products And Raw materials |
|