| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Biphenylboronic acid, pinacol ester Basic information |
| Product Name: | 4-Biphenylboronic acid, pinacol ester | | Synonyms: | 4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)DIPHENYL;4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BIPHENYL;2-(4-biphenylyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;)-4,4,5,5-tetramethyL;2-(4-BiphenyL;4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-;4-BIPHENYLBORONIC ACID, PICOL ESTER;4-Biphenylboronic acid pinacol ester, 98.5% | | CAS: | 144432-80-4 | | MF: | C18H21BO2 | | MW: | 280.17 | | EINECS: | | | Product Categories: | B (Classes of Boron Compounds);Boronic Acids Esters | | Mol File: | 144432-80-4.mol |  |
| | 4-Biphenylboronic acid, pinacol ester Chemical Properties |
| Melting point | 112 °C | | Boiling point | 396.0±21.0 °C(Predicted) | | density | 1.05±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder to crystal | | color | White to Almost white | | Water Solubility | Slightly soluble in water. | | InChI | 1S/C18H21BO2/c1-17(2)18(3,4)21-19(20-17)16-12-10-15(11-13-16)14-8-6-5-7-9-14/h5-13H,1-4H3 | | InChIKey | REDKQKNJWVIPIO-UHFFFAOYSA-N | | SMILES | CC(C(C)(C)O1)(C)OB1C2=CC=C(C3=CC=CC=C3)C=C2 | | CAS DataBase Reference | 144432-80-4 |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | 4-Biphenylboronic acid, pinacol ester Usage And Synthesis |
| Chemical Properties | White solid | | Uses | It is an important raw material and intermediate used in organic synthesis and pharmaceuticals. | | Uses | 4-Biphenylboronic Acid, Pinacol Ester is a useful intermediate for organic synthesis and an important raw material for pharmaceuticals. | | Uses | suzuki reaction |
| | 4-Biphenylboronic acid, pinacol ester Preparation Products And Raw materials |
|