- ALLANTOIC ACID
-
-
2025-12-24
- CAS:99-16-1
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 1000KG
- ALLANTOIC ACID
-
- $1.00
-
2020-02-20
- CAS:99-16-1
- Min. Order: 1KG
- Purity: 98% HPLC
- Supply Ability: 10 Tons
|
| | ALLANTOIC ACID Basic information |
| | ALLANTOIC ACID Chemical Properties |
| Melting point | 168 °C | | Boiling point | 439.2±45.0 °C(Predicted) | | density | 1.618±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Aqueous Base (Slightly, Sonicated) | | pka | 2.97±0.10(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C4H8N4O4/c5-3(11)7-1(2(9)10)8-4(6)12/h1H,(H,9,10)(H3,5,7,11)(H3,6,8,12) | | InChIKey | NUCLJNSWZCHRKL-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(NC(N)=O)NC(N)=O | | CAS DataBase Reference | 99-16-1 | | EPA Substance Registry System | Acetic acid, bis[(aminocarbonyl)amino]- (99-16-1) |
| WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2922500090 |
| | ALLANTOIC ACID Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Allantoic acid is used as an metabolic intermediate in nucleic acid metabolism. | | Preparation |
Allantoic acid is a crystalline acid obtained by hydrolysis of allantoin.In nature, allantoic acid is produced from allantoin by the enzyme allantoinase.
| | Definition | ChEBI: A member of the class of ureas that consists of acetic acid in which the two methyl hydrogens are replaced by carbamoylamino groups respectively. |
| | ALLANTOIC ACID Preparation Products And Raw materials |
|