| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Bis(2,2,2-trichloroethyl) azodicarboxylate Basic information |
| Product Name: | Bis(2,2,2-trichloroethyl) azodicarboxylate | | Synonyms: | BIS(2,2,2-TRICHLOROETHYL) AZODI-CARBOXYL ATE, 97+%;AZODICARBOXYLIC ACID BIS(2,2,2-TRICHLOROETHYL) ESTER;Bis(2,2,2-trichloroethyl) azodicarboxyle;BEAZ Bis(2,2,2-trichloroethyl) azodicarboxylate;1,2-Diazenedicarboxylic acid, 1,2-bis(2,2,2-trichloroethyl) ester;Bis(2,2,2-trichloroethyl) azodicarboxylate;Bis(2,2,2-trichloroethyl) azodicarboxylate | | CAS: | 38857-88-4 | | MF: | C6H4Cl6N2O4 | | MW: | 380.83 | | EINECS: | | | Product Categories: | | | Mol File: | 38857-88-4.mol |  |
| | Bis(2,2,2-trichloroethyl) azodicarboxylate Chemical Properties |
| Melting point | 109-111 °C (lit.) | | Boiling point | 380.7±42.0 °C(Predicted) | | density | 1.78±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | sol in a wide range of organic solvents. | | form | solid | | color | slightly yellow | | BRN | 2141527 | | InChI | 1S/C6H4Cl6N2O4/c7-5(8,9)1-17-3(15)13-14-4(16)18-2-6(10,11)12/h1-2H2/b14-13+ | | InChIKey | LIEOEYTUTSDYKB-BUHFOSPRSA-N | | SMILES | ClC(Cl)(Cl)COC(=O)\N=N\C(=O)OCC(Cl)(Cl)Cl | | CAS DataBase Reference | 38857-88-4 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Bis(2,2,2-trichloroethyl) azodicarboxylate Usage And Synthesis |
| Chemical Properties | Yellow powder or crystals | | Uses | Bis(2,2,2-trichloroethyl) azodicarboxylate has been used:
- in the asymmetric synthesis of substituted cycloalkyl[b]indoles
- as amination reagent during the aza-ene reaction of different alkenes to yield the corresponding allyl amines
- in para-directed amination of C2-alkyl substituted anisole
- in the synthesis of acid- and base-sensitive azo compounds and in Diels-Alder cycloadditions
| | General Description | Thermal inverse-type hetero-Diels-Alder reaction of O-silyl-protected lactal and bis(2,2,2-trichloroethyl) azodicarboxylate has been reported. | | storage | Bis(2,2,2-trichloroethyl) azodicarboxylate is same as with all azo compounds, caution should be exercised to avoid
exposure of the material to heat. Store in a brown bottle. |
| | Bis(2,2,2-trichloroethyl) azodicarboxylate Preparation Products And Raw materials |
|