1-Boc-3,3-dimethylpiperazine manufacturers
|
| | 1-Boc-3,3-dimethylpiperazine Basic information |
| Product Name: | 1-Boc-3,3-dimethylpiperazine | | Synonyms: | 109678;3,3-Dimethylpiperazine-1-carboxylic acid tert-butyl ester;1-Boc-3,3-dimethylpiperazine;1-Piperazinecarboxylic acid, 3,3-dimethyl-, 1,1-dimethylethyl ester;1-(tert-butoxycarbinyl)-3,3-dimethyl-piperazine 97%;1-Boc-3,3-dimethypiperazine;1-Piperazinecarboxylic acid, 3,3-dimethyl-, 1,1-dimethylethyl ester (9CI, ACI);3,3-dimethyl-1-Piperazinecarboxylic acid 1,1-dimethylethyl ester (9CI ACI) | | CAS: | 259808-67-8 | | MF: | C11H22N2O2 | | MW: | 214.3 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 259808-67-8.mol |  |
| | 1-Boc-3,3-dimethylpiperazine Chemical Properties |
| Boiling point | 275.1±15.0 °C(Predicted) | | density | 0.977±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 8.58±0.40(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C11H22N2O2/c1-10(2,3)15-9(14)13-7-6-12-11(4,5)8-13/h12H,6-8H2,1-5H3 | | InChIKey | LBAIYWWWORXVEQ-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCNC(C)(C)C1 |
| | 1-Boc-3,3-dimethylpiperazine Usage And Synthesis |
| References | [1] Patent: US2008/76758, 2008, A1. Location in patent: Page/Page column 90
[2] Patent: EP1104754, 2001, A1
[3] Patent: WO2014/96151, 2014, A2. Location in patent: Page/Page column 43
[4] Patent: WO2018/218197, 2018, A2. Location in patent: Paragraph 0369 |
| | 1-Boc-3,3-dimethylpiperazine Preparation Products And Raw materials |
|