|
|
| | (E)-3-(dimethylamino)-1-phenylprop-2-en-1-one Basic information |
| Product Name: | (E)-3-(dimethylamino)-1-phenylprop-2-en-1-one | | Synonyms: | (E)-3-(dimethylamino)-1-phenylprop-2-en-1-one;2-Propen-1-one, 3-(dimethylamino)-1-phenyl-, (E)-;2-Propen-1-one, 3-(dimethylamino)-1-phenyl-, (2E)-;3- (dimethylamino) -1- (2-phenyl) -2-propen-1-one;(E)-3-(Dimethylamino)-1-phenylprop-2-en-1-one - [D90449] | | CAS: | 1131-80-2 | | MF: | C11H13NO | | MW: | 175.23 | | EINECS: | | | Product Categories: | | | Mol File: | 1131-80-2.mol |  |
| | (E)-3-(dimethylamino)-1-phenylprop-2-en-1-one Chemical Properties |
| Melting point | 91 °C | | Boiling point | 260.0±32.0 °C(Predicted) | | density | 1.022±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 5.54±0.70(Predicted) | | Appearance | Light yellow to green yellow Solid | | InChI | InChI=1S/C11H13NO/c1-12(2)9-8-11(13)10-6-4-3-5-7-10/h3-9H,1-2H3/b9-8+ | | InChIKey | HUTKDPINCSJXAA-CMDGGOBGSA-N | | SMILES | C(C1=CC=CC=C1)(=O)/C=C/N(C)C |
| | (E)-3-(dimethylamino)-1-phenylprop-2-en-1-one Usage And Synthesis |
| Definition | ChEBI: 3-(dimethylamino)-1-phenylprop-2-en-1-one is a carbonyl compound. |
| | (E)-3-(dimethylamino)-1-phenylprop-2-en-1-one Preparation Products And Raw materials |
|