|
|
| | Benzenemethanamine, 2-chloro-a-methyl-,(S)- Basic information |
| Product Name: | Benzenemethanamine, 2-chloro-a-methyl-,(S)- | | Synonyms: | Benzenemethanamine, 2-chloro-a-methyl-,(S)-;(1S)-1-(2-CHLOROPHENYL)ETHAN-1-AMINE-HCL;(1S)-1-(2-CHLOROPHENYL)ETHAN-1-AMINE;Benzenemethamine, 2-chloro-a-methyl-,(S)-;(S)-1-(2-CHLOROPHENYL)ETHANAMINE-HCl;(alphaS)-2-Chloro-alpha-methylbenzenemethanamine;(S)-2-Chloro-alpha-methylbenzenemethanamine;Benzenemethanamine, 2-chloro-α-methyl-, (αS)- | | CAS: | 68285-26-7 | | MF: | C8H10ClN | | MW: | 155.62 | | EINECS: | | | Product Categories: | API intermediates | | Mol File: | 68285-26-7.mol |  |
| | Benzenemethanamine, 2-chloro-a-methyl-,(S)- Chemical Properties |
| Boiling point | 217.4±15.0 °C(Predicted) | | density | 1.122 | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 8.50±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | Optical Rotation | -36.3°(C=0.01g/ml DCM) | | InChI | InChI=1/C8H10ClN/c1-6(10)7-4-2-3-5-8(7)9/h2-6H,10H2,1H3/t6-/s3 | | InChIKey | RJPLGQTZHLRZGX-ISZMHOAENA-N | | SMILES | N[C@H](C1C=CC=CC=1Cl)C |&1:1,r| |
| | Benzenemethanamine, 2-chloro-a-methyl-,(S)- Usage And Synthesis |
| | Benzenemethanamine, 2-chloro-a-methyl-,(S)- Preparation Products And Raw materials |
|