| Company Name: |
Chemsky (shanghai) International Co.,Ltd
|
| Tel: |
021-50135380 |
| Email: |
shchemsky@sina.com |
| Products Intro: |
Product Name:Iodobenzene-13C6;1-Iodobenzene-13C6; Benzene-13C6 Iodide; NSC 9244-13C6; Phenyl-13C6 Iodide; CAS:104130-35-0 Purity:98+% Package:1Mg;5Mg;10Mg;50Mg;100Mg;500Mg
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:Iodobenzene-13C6 CAS:104130-35-0 Purity:NULL Package:10mg Remarks:NULL
|
| Company Name: |
SHANGHAI ZZBIO CO., LTD.
|
| Tel: |
13795317828 18901678489 |
| Email: |
tech@zzbioco.com |
| Products Intro: |
Product Name:U-Ring-13C6]-Iodobenzene CAS:104130-35-0 Purity:CP:95%;98%atom Package:1mg
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Iodobenzene-13C6 CAS:104130-35-0
|
|
| | IODOBENZENE-13C6 Basic information |
| | IODOBENZENE-13C6 Chemical Properties |
| Melting point | -29 °C(lit.) | | Boiling point | 188 °C(lit.) | | density | 1.876 g/mL at 25 °C | | Fp | 77°C | | form | solid | | InChI | 1S/C6H5I/c7-6-4-2-1-3-5-6/h1-5H/i1+1,2+1,3+1,4+1,5+1,6+1 | | InChIKey | SNHMUERNLJLMHN-IDEBNGHGSA-N | | SMILES | I[13c]1[13cH][13cH][13cH][13cH][13cH]1 |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral |
| | IODOBENZENE-13C6 Usage And Synthesis |
| Uses | Iodobenzene-13C6 is used for preparation of uniformly labeled 13C polychlorobiphenyl (PCB) standard. | | Uses | Used for preparation of uniformly Labelled 13C polychlorobiphenyl (PCB) standard. |
| | IODOBENZENE-13C6 Preparation Products And Raw materials |
|