| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Iodobenzene-13C6 Basic information |
| | Iodobenzene-13C6 Chemical Properties |
| Melting point | -29 °C(lit.) | | Boiling point | 188 °C(lit.) | | density | 1.876 g/mL at 25 °C | | Fp | 77°C | | form | solid | | InChI | 1S/C6H5I/c7-6-4-2-1-3-5-6/h1-5H/i1+1,2+1,3+1,4+1,5+1,6+1 | | InChIKey | SNHMUERNLJLMHN-IDEBNGHGSA-N | | SMILES | I[13c]1[13cH][13cH][13cH][13cH][13cH]1 |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Iodobenzene-13C6 Usage And Synthesis |
| Uses | Iodobenzene-13C6 is used for preparation of uniformly labeled 13C polychlorobiphenyl (PCB) standard. | | Uses | Used for preparation of uniformly Labelled 13C polychlorobiphenyl (PCB) standard. |
| | Iodobenzene-13C6 Preparation Products And Raw materials |
|