| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | Benzene (13C6) Basic information |
| Product Name: | Benzene (13C6) | | Synonyms: | [phenyl-U-13C6]Benzene;BENZENE-13C6, 99 ATOM % 13C;Benzene-13C6;Benzene (13C?, 99%);Benzene (13C6) | | CAS: | 32488-44-1 | | MF: | C6H6 | | MW: | 84.17 | | EINECS: | | | Product Categories: | | | Mol File: | 32488-44-1.mol |  |
| | Benzene (13C6) Chemical Properties |
| Melting point | 5.5 °C(lit.) | | Boiling point | 80 °C(lit.) | | density | 0.940 g/mL at 25 °C | | refractive index | n20/D 1.501(lit.) | | Fp | 12 °F | | solubility | Chloroform (Slightly), Dichloromethane (Slightly), Methanol (Slightly) | | form | Liquid | | color | Colourless | | InChI | 1S/C6H6/c1-2-4-6-5-3-1/h1-6H/i1+1,2+1,3+1,4+1,5+1,6+1 | | InChIKey | UHOVQNZJYSORNB-IDEBNGHGSA-N | | SMILES | [13cH]1[13cH][13cH][13cH][13cH][13cH]1 | | CAS Number Unlabeled | 71-43-2 |
| Hazard Codes | F,T | | Risk Statements | 45-46-11-36/38-48/23/24/25-65 | | Safety Statements | 53-45 | | RIDADR | UN 1114 3/PG 2 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Chronic 3
Asp. Tox. 1
Carc. 1A
Eye Irrit. 2
Flam. Liq. 2
Muta. 1B
Skin Irrit. 2
STOT RE 1 |
| | Benzene (13C6) Usage And Synthesis |
| Chemical Properties | Clear Colourless Oil | | Uses | Isotope labelled benzene, an organic compound that is a natural constituent of crude oil and one of the most basic petrochemicals. |
| | Benzene (13C6) Preparation Products And Raw materials |
|