| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-Benzyl-4-cyano-4-piperidinecarboxylic acid ethyl ester Basic information |
| Product Name: | 1-Benzyl-4-cyano-4-piperidinecarboxylic acid ethyl ester | | Synonyms: | 4-Piperidinecarboxylic acid, 4-cyano-1-(phenylMethyl)-, ethyl ester;1-Benzyl-4-cyano-piperidine-4-carboxylic acid ethyl ester;4-(B1-BENZYL-4-CYANO-4-PIPERIDINECARBOXYLIC ACID ETHYL ESTER
ROMOMETHYL)PHENYLACETIC ACID;ethyl 1-benzyl-4-cyanopiperidine-4-carboxylate;Ethyl 4-cyano-1-(phenylmethyl)-4-piperidinecarboxylate;131-Benzyl-4-cyano-4-piperidinic acid Ethyl ester;1-Benzyl-4-cyano-4-piperidinecarboxylic acid ethyl ester | | CAS: | 123730-67-6 | | MF: | C16H20N2O2 | | MW: | 272.34 | | EINECS: | | | Product Categories: | | | Mol File: | 123730-67-6.mol |  |
| | 1-Benzyl-4-cyano-4-piperidinecarboxylic acid ethyl ester Chemical Properties |
| Boiling point | 395.0±42.0 °C(Predicted) | | density | 1.13±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 5.86±0.10(Predicted) | | Appearance | Off-white to pink Solid | | InChI | InChI=1S/C16H20N2O2/c1-2-20-15(19)16(13-17)8-10-18(11-9-16)12-14-6-4-3-5-7-14/h3-7H,2,8-12H2,1H3 | | InChIKey | FPMGPVRBKDTWFD-UHFFFAOYSA-N | | SMILES | N1(CC2=CC=CC=C2)CCC(C#N)(C(OCC)=O)CC1 | | CAS DataBase Reference | 123730-67-6 |
| | 1-Benzyl-4-cyano-4-piperidinecarboxylic acid ethyl ester Usage And Synthesis |
| | 1-Benzyl-4-cyano-4-piperidinecarboxylic acid ethyl ester Preparation Products And Raw materials |
|