|
|
| | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline Basic information |
| Product Name: | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline | | Synonyms: | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline;Isoquinoline-6-boronic acid pinacol ester;6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ISOQUINOLINE 97%;Isoquinoline-6-boronic acid picol ester;Isoquinoline, 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-;6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline (>85%) | | CAS: | 675576-26-8 | | MF: | C15H18BNO2 | | MW: | 255.12 | | EINECS: | | | Product Categories: | | | Mol File: | 675576-26-8.mol |  |
| | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline Chemical Properties |
| Melting point | 179-184°C | | Boiling point | 397.5±15.0 °C(Predicted) | | density | 1.10±0.1 g/cm3 (20 ºC 760 Torr) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | solid | | pka | 5.03±0.14(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | 1S/C15H18BNO2/c1-14(2)15(3,4)19-16(18-14)13-6-5-12-10-17-8-7-11(12)9-13/h5-10H,1-4H3 | | InChIKey | LFALMDZWCMSBFO-UHFFFAOYSA-N | | SMILES | CC1(C)OB(OC1(C)C)c2ccc3cnccc3c2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline Usage And Synthesis |
| Uses | Useful boron compound for Suzuki coupling. | | Synthesis | A mixture of 6-bromoisoquinoline (208 mg, 1 mmol), bis(pinacolato)diboronate (279 mg, 1.1 mmol), KOAc (323 mg, 3.3 mmol) and Pd(dppf)2Cl2 (73 mg, 0.1 mmol) in DMSO (3 mL) was heated in microwave at 160 C for 10 minutes. The mixture was diluted with water (20 mL) and extracted with EtOAc (4x 20 mL). The combined EtOAc was washed with water (15 mL) and brine (15 mL) and dried (Na2SO4). The solvent was removed to give isoquinoline-6-boronic acid pinacol ester. |
| | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline Preparation Products And Raw materials |
|