- ISOQUINOLIN-3-AMINE
-
- $1.10
-
2025-11-18
- CAS:25475-67-6
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons
- ISOQUINOLIN-3-AMINE
-
- $8.00
-
2019-07-06
- CAS: 25475-67-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10tons
|
| | Isoquinolin-3-amine Basic information |
| | Isoquinolin-3-amine Chemical Properties |
| Melting point | 154-156°C | | Boiling point | 331.2±15.0 °C(Predicted) | | density | 1.210±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | solid | | pka | 5.05(at 20℃) | | color | Yellow/green | | InChI | InChI=1S/C9H8N2/c10-9-5-7-3-1-2-4-8(7)6-11-9/h1-6H,(H2,10,11) | | InChIKey | VYCKDIRCVDCQAE-UHFFFAOYSA-N | | SMILES | C1C2=C(C=CC=C2)C=C(N)N=1 | | CAS DataBase Reference | 25475-67-6(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39-24/25-37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2933491090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Isoquinolin-3-amine Usage And Synthesis |
| Definition | Isoquinolin-3-amines bearing an alkyl group or hydrogen atom in position 4 easily underwent Buchwald-Hartwig coupling reactions with various substituted aryl halide[1]. | | References | [1] Jozsef A Balog. “Novel fluorescent isoquinoline derivatives obtained via Buchwald-Hartwig coupling of isoquinolin-3-amines.” Arkivoc 2012 1 (2012): 109–119. |
| | Isoquinolin-3-amine Preparation Products And Raw materials |
|