|
|
| | 2-(4-Chlorophenyl)-1,3-dioxolane Basic information |
| Product Name: | 2-(4-Chlorophenyl)-1,3-dioxolane | | Synonyms: | 1-(1,3-Dioxolane-2-yl)-4-chlorobenzene;2-(p-Chlorophenyl)-1,3-dioxolane;4-Chlorobenzaldehyde ethylene acetal;1,3-Dioxolane, 2-(4-chlorophenyl)-;1,3-Dioxolane, 2-(p-chlorophenyl)-;Nsc202824;2-(4-chlorophenyl)-1,3-dioxolane | | CAS: | 2403-54-5 | | MF: | C9H9ClO2 | | MW: | 184.62 | | EINECS: | | | Product Categories: | | | Mol File: | 2403-54-5.mol |  |
| | 2-(4-Chlorophenyl)-1,3-dioxolane Chemical Properties |
| Boiling point | 136-139 °C(Press: 13 Torr) | | density | 1.256±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C9H9ClO2/c10-8-3-1-7(2-4-8)9-11-5-6-12-9/h1-4,9H,5-6H2 | | InChIKey | NYXNQWTXUSTEGL-UHFFFAOYSA-N | | SMILES | O1CCOC1C1=CC=C(Cl)C=C1 |
| | 2-(4-Chlorophenyl)-1,3-dioxolane Usage And Synthesis |
| | 2-(4-Chlorophenyl)-1,3-dioxolane Preparation Products And Raw materials |
|